Learn More
Nicorandil, 98+%, Thermo Scientific™
A vasodilator that activates ATP-sensitive potassium channels
Brand: Thermo Scientific Alfa Aesar J60879.MD
| Quantity | 250mg |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 65141-46-0 | |
| 211.18 | |
| LBHIOVVIQHSOQN-UHFFFAOYSA-N | |
| 47528 | |
| 2-[(pyridin-3-yl)formamido]ethyl nitrate |
| C8H9N3O4 | |
| MFCD00186520 | |
| nicorandil, ikorel, 2-nicotinamidoethyl nitrate, adancor, dancor, nicorandilum, sigmart, 2-pyridine-3-carbonylamino ethyl nitrate, n-2-hydroxyethyl nicotinamide nitrate, nicorandilum inn-latin | |
| CHEBI:31905 | |
| [O-][N+](=O)OCCNC(=O)C1=CC=CN=C1 |
Specifications
| 65141-46-0 | |
| MFCD00186520 | |
| 14,6521 | |
| LBHIOVVIQHSOQN-UHFFFAOYSA-N | |
| 2-[(pyridin-3-yl)formamido]ethyl nitrate | |
| 47528 | |
| 211.17 | |
| Nicorandil |
| C8H9N3O4 | |
| 250mg | |
| nicorandil, ikorel, 2-nicotinamidoethyl nitrate, adancor, dancor, nicorandilum, sigmart, 2-pyridine-3-carbonylamino ethyl nitrate, n-2-hydroxyethyl nicotinamide nitrate, nicorandilum inn-latin | |
| [O-][N+](=O)OCCNC(=O)C1=CC=CN=C1 | |
| 211.18 | |
| CHEBI:31905 | |
| ≥98% |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.