missing translation for 'onlineSavingsMsg'
Learn More
Learn More
HEPES (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent.
Brand: Fisher Bioreagents BP310-1
77.90 EUR valid until 2023-06-30
Use promo code "19140" to get your promotional price.
Additional Details : CAS : 7365-45-9 Weight : 1.10732kg
Description
Commonly used buffering agent
HEPES is commonly used as a buffering agent.Specifications
| HEPES | |
| 7365-45-9 | |
| ≥99 % | |
| MFCD00006158 | |
| N-(2-Hydroxyethyl)piperazine-N«-2-ethanesulfonic Acid | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 238.30 | |
| 23831 | |
| 260.28 | |
| ≥99% | |
| 5.0 to 6.5 | |
| Soluble in water | |
| Pass Test | |
| 7.3 to 7.7 (at 25°C) | |
| Single spot |
| 0.01 max. (0.1M solution) at 280nm | |
| DNase-, RNase- and Protease-Free | |
| C8H18N2O4S | |
| 15, 4689 | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonic acid | |
| White | |
| CHEBI:42334 | |
| Powder/Solid | |
| Molecular Biology | |
| 1kg | |
| DNase free | |
| Poly Bottle | |
| Protease free |