missing translation for 'onlineSavingsMsg'
Läs mer
Läs mer
Florfenicol, 98%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J66995.03
| Quantity | 1g |
|---|
Denna artikel kan inte returneras.
Se returpolicy
Beskrivning
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- A bacteriostatic antibiotic similar to chloramphenicol which inhibits bacterial protein synthesis
Kemiska identifierare
| 73231-34-2 | |
| 358.205 | |
| AYIRNRDRBQJXIF-NXEZZACHSA-N | |
| CHEBI:87185 | |
| CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)NC(=O)C(Cl)Cl)O |
| C12H14Cl2FNO4S | |
| MFCD00864834 | |
| 114811 | |
| 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
Specifikationer
| 73231-34-2 | |
| 1g | |
| C12H14Cl2FNO4S | |
| 618°C | |
| Soluble in ethanol to 25mM and in DMSO to 100mM | |
| CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)NC(=O)C(Cl)Cl)O | |
| 358.205 | |
| CHEBI:87185 | |
| 98% |
| White | |
| >110°C (230°F) | |
| MFCD00864834 | |
| 14,4109 | |
| AYIRNRDRBQJXIF-NXEZZACHSA-N | |
| 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | |
| 114811 | |
| 358.21 | |
| Florfenicol |
Korrigering av produktinnehåll
Din input är viktig för oss. Fyll i det här formuläret för att ge feedback relaterad till innehållet på denna produkt.
Produkttitel
Hittar du en möjlighet till förbättring?Dela en innehållskorrigering