Learn More
Berberine chloride hydrate, 96%, water <17%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar L03807.14
| Quantity | 25g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsPrimarily for the treatment of gastroenteritis, dysentery and other intestinal infections and conjunctivitis, purulent otitis media.
Solubility
Soluble in water.
Notes
Light sensitive. Store in the dark. Store away from oxidizing agents, light.
Chemical Identifiers
| 141433-60-5 | |
| 389.832 | |
| BPNJXFPOPCFZOC-UHFFFAOYSA-M | |
| 155074 |
| C20H20ClNO5 | |
| MFCD00149998 | |
| berberine chloride hydrate, 9,10-dimethoxy-5,6-dihydro-1,3 dioxolo 4,5-g isoquinolino 3,2-a isoquinolin-7-ium chloride hydrate, c20h18no4.cl.h2o, benzo g-1,3-benzodioxolo 5,6-a quinolizinium, 5,6-dihydro-9,10-dimethoxy-, chloride, monohydrate, kyoberin tn, 9,10-dimethoxy-5,6-dihydro-2h-1,3-dioxolano 4,5-g isoquinolino 3,2-a isoquinol ine, chloride, hydrate, berberinechloridehydrate, berberine chloride xhydrate, berberine chloride hydrate jp17 | |
| COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.O.[Cl-] |
Specifications
| 141433-60-5 | |
| MFCD00149998 | |
| 3836585 | |
| 14,1154 | |
| Soluble in water. | |
| COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.O.[Cl-] | |
| 155074 | |
| 97% | |
| Berberine chloride hydrate |
| C20H20ClNO5 | |
| 25g | |
| Light Sensitive | |
| berberine chloride hydrate, 9,10-dimethoxy-5,6-dihydro-1,3 dioxolo 4,5-g isoquinolino 3,2-a isoquinolin-7-ium chloride hydrate, c20h18no4.cl.h2o, benzo g-1,3-benzodioxolo 5,6-a quinolizinium, 5,6-dihydro-9,10-dimethoxy-, chloride, monohydrate, kyoberin tn, 9,10-dimethoxy-5,6-dihydro-2h-1,3-dioxolano 4,5-g isoquinolino 3,2-a isoquinol ine, chloride, hydrate, berberinechloridehydrate, berberine chloride xhydrate, berberine chloride hydrate jp17 | |
| BPNJXFPOPCFZOC-UHFFFAOYSA-M | |
| 389.832 | |
| 371.82 (Anhydrous) | |
| water <17% |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.