Learn More
Acebutolol hydrochloride, Thermo Scientific™
Cardioselective beta-adrenergic blocker
Brand: Thermo Scientific Alfa Aesar J63790.06
| Quantity | 5g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 34381-68-5 | |
| 372.89 | |
| KTUFKADDDORSSI-UHFFFAOYNA-N | |
| 441307 | |
| hydrogen N-(3-acetyl-4-{2-hydroxy-3-[(propan-2-yl)amino]propoxy}phenyl)butanamide chloride |
| C18H29ClN2O4 | |
| MFCD00078860 | |
| acebutolol hydrochloride, acebutolol hcl, n-3-acetyl-4-2-hydroxy-3-isopropylamino propoxy phenyl butyramide hydrochloride, diasectral, wesfalin, 3'-acetyl-4'-2-hydroxy-3-isopropylamino propoxy butyranilide hydrochloride, dl-1-2-acetyl-4-butyramidophenoxy-2-hydroxy-3-isopropylaminopropane hydrochloride, ccris 1102, sectral tn | |
| CHEBI:2380 | |
| [H+].[Cl-].CCCC(=O)NC1=CC=C(OCC(O)CNC(C)C)C(=C1)C(C)=O |
Specifications
| 34381-68-5 | |
| MFCD00078860 | |
| 14,19 | |
| KTUFKADDDORSSI-UHFFFAOYNA-N | |
| hydrogen N-(3-acetyl-4-{2-hydroxy-3-[(propan-2-yl)amino]propoxy}phenyl)butanamide chloride | |
| 441307 | |
| 372.89 |
| C18H29ClN2O4 | |
| 5g | |
| acebutolol hydrochloride, acebutolol hcl, n-3-acetyl-4-2-hydroxy-3-isopropylamino propoxy phenyl butyramide hydrochloride, diasectral, wesfalin, 3'-acetyl-4'-2-hydroxy-3-isopropylamino propoxy butyranilide hydrochloride, dl-1-2-acetyl-4-butyramidophenoxy-2-hydroxy-3-isopropylaminopropane hydrochloride, ccris 1102, sectral tn | |
| [H+].[Cl-].CCCC(=O)NC1=CC=C(OCC(O)CNC(C)C)C(=C1)C(C)=O | |
| 372.89 | |
| CHEBI:2380 | |
| Acebutolol hydrochloride |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.