Filtered Search Results
Zinc Sulfate Heptahydrate, Certified AR for Analysis, 99.5-100.5%, Fisher Chemical™
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Zinc chloride, anhydrous, 98+%
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Zinc nitrate hexahydrate, 98%, extra pure
CAS: 10196-18-6 Molecular Formula: H12N2O12Zn Molecular Weight (g/mol): 297.48 MDL Number: MFCD00149889 InChI Key: JGPSMWXKRPZZRG-UHFFFAOYSA-N Synonym: zinc nitrate hexahydrate,zinc ii nitrte,zincnitratehexahydrate,acmc-1bzdd,n2o6zn.6h2o,ksc176g7t,zinc nitrate hexahydrate, puratronic,zinc nitrate,zinc 2+ hexahydrate dinitrate,zinc nitrate hexahydrate, p.a PubChem CID: 15865313 SMILES: O.O.O.O.O.O.[Zn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 15865313 |
|---|---|
| CAS | 10196-18-6 |
| Molecular Weight (g/mol) | 297.48 |
| MDL Number | MFCD00149889 |
| SMILES | O.O.O.O.O.O.[Zn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | zinc nitrate hexahydrate,zinc ii nitrte,zincnitratehexahydrate,acmc-1bzdd,n2o6zn.6h2o,ksc176g7t,zinc nitrate hexahydrate, puratronic,zinc nitrate,zinc 2+ hexahydrate dinitrate,zinc nitrate hexahydrate, p.a |
| InChI Key | JGPSMWXKRPZZRG-UHFFFAOYSA-N |
| Molecular Formula | H12N2O12Zn |
Zinc sulfate heptahydrate, 99%, ACS reagent
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Zinc sulfate heptahydrate, 99.5%, for analysis
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 IUPAC Name: zinc;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| IUPAC Name | zinc;sulfate;heptahydrate |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
| Linear Formula | ZnCl2 |
|---|---|
| Molecular Weight (g/mol) | 136.29 |
| ChEBI | CHEBI:49976 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Zinc chloride |
| SMILES | Cl[Zn]Cl |
| Merck Index | 15, 10331 |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Density | 1.0700g/mL |
| PubChem CID | 5727 |
| Name Note | 2M solution in 2-Methyltetrahydrofuran |
| Concentration or Composition (by Analyte or Components) | 23 to 27% |
| CAS | 96-47-9 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00011295 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May cause respiratory irritation. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. May form explos |
| Flash Point | −11°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| Molecular Formula | Cl2Zn |
| EINECS Number | 231-592- |
| Formula Weight | 136.29 |
| Specific Gravity | 1.07 |
Zinc sulfate heptahydrate, 98%
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Zinc sulfate monohydrate, 99%
CAS: 7446-19-7 Molecular Formula: O4SZn·H2O Molecular Weight (g/mol): 179.47 MDL Number: MFCD00149893 InChI Key: RNZCSKGULNFAMC-UHFFFAOYSA-L Synonym: zinc sulfate monohydrate,zinc sulfate hydrate,unii-ptx099xsf1,ptx099xsf1,sulfuric acid, zinc salt 1:1 , monohydrate,zinc sulphate monohydrate,gunningite,sulfato de zinc monohydratado,zinc sulfate tn,zinc sulfate,monohydrate PubChem CID: 62639 IUPAC Name: zinc;sulfate;hydrate SMILES: O.[O-]S(=O)(=O)[O-].[Zn+2]
| PubChem CID | 62639 |
|---|---|
| CAS | 7446-19-7 |
| Molecular Weight (g/mol) | 179.47 |
| MDL Number | MFCD00149893 |
| SMILES | O.[O-]S(=O)(=O)[O-].[Zn+2] |
| Synonym | zinc sulfate monohydrate,zinc sulfate hydrate,unii-ptx099xsf1,ptx099xsf1,sulfuric acid, zinc salt 1:1 , monohydrate,zinc sulphate monohydrate,gunningite,sulfato de zinc monohydratado,zinc sulfate tn,zinc sulfate,monohydrate |
| IUPAC Name | zinc;sulfate;hydrate |
| InChI Key | RNZCSKGULNFAMC-UHFFFAOYSA-L |
| Molecular Formula | O4SZn·H2O |
Zinc chloride, 98%, extra pure
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.29 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.29 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Zinc oxide, ACS reagent
CAS: 1314-13-2 Molecular Formula: OZn Molecular Weight (g/mol): 81.38 MDL Number: MFCD00011300 InChI Key: XLOMVQKBTHCTTD-UHFFFAOYSA-N Synonym: zinc oxide,zinc white,amalox,permanent white,Chinese white,snow white,emanay zinc oxide,felling zinc oxide,zinc oxide zno,akro-zinc bar 85 PubChem CID: 14806 ChEBI: CHEBI:36560 IUPAC Name: oxozinc SMILES: O=[Zn]
| PubChem CID | 14806 |
|---|---|
| CAS | 1314-13-2 |
| Molecular Weight (g/mol) | 81.38 |
| ChEBI | CHEBI:36560 |
| MDL Number | MFCD00011300 |
| SMILES | O=[Zn] |
| Synonym | zinc oxide,zinc white,amalox,permanent white,Chinese white,snow white,emanay zinc oxide,felling zinc oxide,zinc oxide zno,akro-zinc bar 85 |
| IUPAC Name | oxozinc |
| InChI Key | XLOMVQKBTHCTTD-UHFFFAOYSA-N |
| Molecular Formula | OZn |
Zinc sulfate heptahydrate, ACS, 99.0-103.0%
CAS: 7446-20-0 Molecular Formula: H14O11SZn Molecular Weight (g/mol): 287.54 MDL Number: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Synonym: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 IUPAC Name: zinc;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| PubChem CID | 62640 |
|---|---|
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| MDL Number | MFCD00149894 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| Synonym | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
| IUPAC Name | zinc;sulfate;heptahydrate |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
| Molecular Formula | H14O11SZn |
Zinc Chloride, Certified AR for Analysis, Fisher Chemical™
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: 11295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | 11295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Zinc bromide, anhydrous, 98%
CAS: 7699-45-8 Molecular Formula: Br2Zn Molecular Weight (g/mol): 225.188 MDL Number: MFCD00011294 InChI Key: VNDYJBBGRKZCSX-UHFFFAOYSA-L Synonym: zincbromide,zinc ii bromide,acmc-209p7h,zinc 2+ ion dibromide,ksc378m6n,zinc bromide hydrate, puratronic™,zinc bromide, anhydrous 100g PubChem CID: 10421208 IUPAC Name: zinc;dibromide SMILES: [Zn+2].[Br-].[Br-]
| PubChem CID | 10421208 |
|---|---|
| CAS | 7699-45-8 |
| Molecular Weight (g/mol) | 225.188 |
| MDL Number | MFCD00011294 |
| SMILES | [Zn+2].[Br-].[Br-] |
| Synonym | zincbromide,zinc ii bromide,acmc-209p7h,zinc 2+ ion dibromide,ksc378m6n,zinc bromide hydrate, puratronic™,zinc bromide, anhydrous 100g |
| IUPAC Name | zinc;dibromide |
| InChI Key | VNDYJBBGRKZCSX-UHFFFAOYSA-L |
| Molecular Formula | Br2Zn |
Zinc acetate, 99%, pure
CAS: 557-34-6 Molecular Formula: C4H6O4Zn Molecular Weight (g/mol): 183.48 MDL Number: MFCD00012454 InChI Key: DJWUNCQRNNEAKC-UHFFFAOYSA-L Synonym: zinc acetate,zinc diacetate,zinc ii acetate,acetic acid, zinc salt,dicarbomethoxyzinc,acetic acid, zinc ii salt,zinc di acetate,galzin,zinc acetate anhydrous,siltex cl 4 PubChem CID: 11192 ChEBI: CHEBI:62984 IUPAC Name: zinc;diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Zn+2]
| PubChem CID | 11192 |
|---|---|
| CAS | 557-34-6 |
| Molecular Weight (g/mol) | 183.48 |
| ChEBI | CHEBI:62984 |
| MDL Number | MFCD00012454 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Zn+2] |
| Synonym | zinc acetate,zinc diacetate,zinc ii acetate,acetic acid, zinc salt,dicarbomethoxyzinc,acetic acid, zinc ii salt,zinc di acetate,galzin,zinc acetate anhydrous,siltex cl 4 |
| IUPAC Name | zinc;diacetate |
| InChI Key | DJWUNCQRNNEAKC-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Zn |
Zinc bromide, 98%, extra pure, anhydrous
CAS: 7699-45-8 Molecular Formula: Br2Zn Molecular Weight (g/mol): 225.19 InChI Key: VNDYJBBGRKZCSX-UHFFFAOYSA-L Synonym: zincbromide,zinc ii bromide,acmc-209p7h,zinc 2+ ion dibromide,ksc378m6n,zinc bromide hydrate, puratronic™,zinc bromide, anhydrous 100g PubChem CID: 10421208 IUPAC Name: zinc;dibromide SMILES: [Zn+2].[Br-].[Br-]
| PubChem CID | 10421208 |
|---|---|
| CAS | 7699-45-8 |
| Molecular Weight (g/mol) | 225.19 |
| SMILES | [Zn+2].[Br-].[Br-] |
| Synonym | zincbromide,zinc ii bromide,acmc-209p7h,zinc 2+ ion dibromide,ksc378m6n,zinc bromide hydrate, puratronic™,zinc bromide, anhydrous 100g |
| IUPAC Name | zinc;dibromide |
| InChI Key | VNDYJBBGRKZCSX-UHFFFAOYSA-L |
| Molecular Formula | Br2Zn |