missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Lansoprazole, 98+%, Thermo Scientific™
A proton pump inhibitor
Marke: Thermo Scientific Alfa Aesar J62008.ME
| Quantity | 500mg |
|---|
Dieser Artikel kann nicht zurückgegeben werden.
Rückgaberichtlinie anzeigen
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 103577-45-3 | |
| 369.362 | |
| MJIHNNLFOKEZEW-UHFFFAOYSA-N | |
| 3883 | |
| 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]-1H-benzimidazole |
| C16H14F3N3O2S | |
| MFCD00866873 | |
| lansoprazole, prevacid, bamalite, monolitum, lansoprazol, agopton, limpidex, ogastro, lanzor, opiren | |
| CHEBI:6375 | |
| CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3N2)OCC(F)(F)F |
Spezifikation
| 103577-45-3 | |
| MFCD00866873 | |
| 14,5362 | |
| MJIHNNLFOKEZEW-UHFFFAOYSA-N | |
| 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]-1H-benzimidazole | |
| 3883 | |
| 369.36 | |
| Lansoprazole |
| C16H14F3N3O2S | |
| 500mg | |
| lansoprazole, prevacid, bamalite, monolitum, lansoprazol, agopton, limpidex, ogastro, lanzor, opiren | |
| CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3N2)OCC(F)(F)F | |
| 369.362 | |
| CHEBI:6375 | |
| ≥98% |
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur