Learn More
Flumequine, 98%, Thermo Scientific™
Inhibits topoisomerases in gram negative bacteria
Brand: Thermo Scientific Alfa Aesar J66332.06
| Quantity | 5g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 42835-25-6 | |
| 261.252 | |
| DPSPPJIUMHPXMA-UHFFFAOYSA-N | |
| 3374 | |
| CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2)F)C(=O)O |
| C14H12FNO3 | |
| MFCD00079298 | |
| 9-Fluoro-1,5,6,7-tetrahydro-5-methyl-1-oxopyrido[3,2,1-ij]quinoline-2-carboxylic Acid | |
| CHEBI:85269 |
Specifications
| 42835-25-6 | |
| 5g | |
| C14H12FNO3 | |
| 490724 | |
| 9-Fluoro-1,5,6,7-tetrahydro-5-methyl-1-oxopyrido[3,2,1-ij]quinoline-2-carboxylic Acid | |
| DPSPPJIUMHPXMA-UHFFFAOYSA-N | |
| 261.252 | |
| CHEBI:85269 | |
| 98% |
| White | |
| >110°C (230°F) | |
| MFCD00079298 | |
| 14,4137 | |
| Soluble in DMSO and dilute alkali hydroxides; Insoluble in water | |
| CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2)F)C(=O)O | |
| 3374 | |
| 261.25 | |
| Flumequine |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.