Naphthacenes
- (3)
- (1)
- (7)
- (1)
- (3)
- (1)
- (3)
- (1)
- (1)
- (1)
- (2)
- (2)
- (3)
- (3)
- (3)
- (7)
- (7)
Filtered Search Results
Fullerene powder, 97% C{70}
CAS: 115383-22-7 Molecular Formula: C70 Molecular Weight (g/mol): 840.77 MDL Number: MFCD00282904 InChI Key: ATLMFJTZZPOKLC-UHFFFAOYSA-N Synonym: fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg PubChem CID: 16131935 ChEBI: CHEBI:33195 IUPAC Name: (C\{70}-D\{5h(6)})[5,6]fullerene SMILES: C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27
| PubChem CID | 16131935 |
|---|---|
| CAS | 115383-22-7 |
| Molecular Weight (g/mol) | 840.77 |
| ChEBI | CHEBI:33195 |
| MDL Number | MFCD00282904 |
| SMILES | C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27 |
| Synonym | fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg |
| IUPAC Name | (C\{70}-D\{5h(6)})[5,6]fullerene |
| InChI Key | ATLMFJTZZPOKLC-UHFFFAOYSA-N |
| Molecular Formula | C70 |
Fullerene powder, 99+% C{70}
CAS: 115383-22-7 Molecular Formula: C70 Molecular Weight (g/mol): 840.77 MDL Number: MFCD00282904 InChI Key: ATLMFJTZZPOKLC-UHFFFAOYSA-N Synonym: fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg PubChem CID: 16131935 ChEBI: CHEBI:33195 IUPAC Name: (C\{70}-D\{5h(6)})[5,6]fullerene SMILES: C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27
| PubChem CID | 16131935 |
|---|---|
| CAS | 115383-22-7 |
| Molecular Weight (g/mol) | 840.77 |
| ChEBI | CHEBI:33195 |
| MDL Number | MFCD00282904 |
| SMILES | C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27 |
| Synonym | fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg |
| IUPAC Name | (C\{70}-D\{5h(6)})[5,6]fullerene |
| InChI Key | ATLMFJTZZPOKLC-UHFFFAOYSA-N |
| Molecular Formula | C70 |
2,3-Benzanthracene, 98%
CAS: 92-24-0 Molecular Formula: C18H12 Molecular Weight (g/mol): 228.29 InChI Key: IFLREYGFSNHWGE-UHFFFAOYSA-N Synonym: naphthacene,2,3-benzanthracene,rubene,benz b anthracene,2,3-benzanthrene,chrysogen,hydrocarbon,unii-qyj5z6712r,ccris 1183 PubChem CID: 7080 ChEBI: CHEBI:32600 IUPAC Name: tetracene SMILES: C1=CC=C2C=C3C=C4C=CC=CC4=CC3=CC2=C1
| PubChem CID | 7080 |
|---|---|
| CAS | 92-24-0 |
| Molecular Weight (g/mol) | 228.29 |
| ChEBI | CHEBI:32600 |
| SMILES | C1=CC=C2C=C3C=C4C=CC=CC4=CC3=CC2=C1 |
| Synonym | naphthacene,2,3-benzanthracene,rubene,benz b anthracene,2,3-benzanthrene,chrysogen,hydrocarbon,unii-qyj5z6712r,ccris 1183 |
| IUPAC Name | tetracene |
| InChI Key | IFLREYGFSNHWGE-UHFFFAOYSA-N |
| Molecular Formula | C18H12 |
Fullerene powder, 98+% C{70}
CAS: 115383-22-7 Molecular Formula: C70 Molecular Weight (g/mol): 840.77 MDL Number: MFCD00282904 InChI Key: ATLMFJTZZPOKLC-UHFFFAOYSA-N Synonym: fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg PubChem CID: 16131935 ChEBI: CHEBI:33195 IUPAC Name: (C\{70}-D\{5h(6)})[5,6]fullerene SMILES: C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27
| PubChem CID | 16131935 |
|---|---|
| CAS | 115383-22-7 |
| Molecular Weight (g/mol) | 840.77 |
| ChEBI | CHEBI:33195 |
| MDL Number | MFCD00282904 |
| SMILES | C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27 |
| Synonym | fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg |
| IUPAC Name | (C\{70}-D\{5h(6)})[5,6]fullerene |
| InChI Key | ATLMFJTZZPOKLC-UHFFFAOYSA-N |
| Molecular Formula | C70 |
14-O-Acetyldaunomycinone, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.