Other Solvents
Filtered Search Results
Ethylene Glycol, puriss. p.a., Reag. Ph. Eur., ≥99.5%, Honeywell™ Riedel-de Haen™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 MDL Number: MFCD00002885 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| MDL Number | MFCD00002885 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Pyridine, 99.5%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Chloroform-d, 99.8% (Isotopic)
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Cyclohexane-d12, for NMR, 99.5 atom % D, Thermo Scientific™
CAS: 1735-17-7 Molecular Formula: C6H12 Molecular Weight (g/mol): 96.24 MDL Number: 00044212 InChI Key: XDTMQSROBMDMFD-LBTWDOQPSA-N IUPAC Name: (²H₁₂)cyclohexane SMILES: [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H]
| CAS | 1735-17-7 |
|---|---|
| Molecular Weight (g/mol) | 96.24 |
| MDL Number | 00044212 |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| IUPAC Name | (²H₁₂)cyclohexane |
| InChI Key | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| Molecular Formula | C6H12 |
Acetone-d{6}, 99.9% (Isotopic)
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 MDL Number: MFCD00044635 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| MDL Number | MFCD00044635 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
Deuterium bromide, 48% w/w in D{2}O, 99+% (Isotopic)
CAS: 13536-59-9 Molecular Formula: BrH Molecular Weight (g/mol): 81.918 MDL Number: MFCD00044232 InChI Key: CPELXLSAUQHCOX-DYCDLGHISA-N Synonym: deuterium bromide,hydrobromic acid-d,deutero-bromide,dbr solution,deuterium bromide solution,bromo 2 h,deuterium bromide, 99 atom % d,deuterium bromide w/w in d2o,deuterium bromide 98.0atom%d in d2o,deuterium bromide solution, 47 wt. % in d2o, 99 atom % d PubChem CID: 518779 SMILES: Br
| PubChem CID | 518779 |
|---|---|
| CAS | 13536-59-9 |
| Molecular Weight (g/mol) | 81.918 |
| MDL Number | MFCD00044232 |
| SMILES | Br |
| Synonym | deuterium bromide,hydrobromic acid-d,deutero-bromide,dbr solution,deuterium bromide solution,bromo 2 h,deuterium bromide, 99 atom % d,deuterium bromide w/w in d2o,deuterium bromide 98.0atom%d in d2o,deuterium bromide solution, 47 wt. % in d2o, 99 atom % d |
| InChI Key | CPELXLSAUQHCOX-DYCDLGHISA-N |
| Molecular Formula | BrH |
1-Butanol, 99%, extra pure
CAS: 71-36-3 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00002964 InChI Key: LRHPLDYGYMQRHN-UHFFFAOYSA-N Synonym: 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane PubChem CID: 263 ChEBI: CHEBI:28885 IUPAC Name: butan-1-ol SMILES: CCCCO
| PubChem CID | 263 |
|---|---|
| CAS | 71-36-3 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:28885 |
| MDL Number | MFCD00002964 |
| SMILES | CCCCO |
| Synonym | 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane |
| IUPAC Name | butan-1-ol |
| InChI Key | LRHPLDYGYMQRHN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
2,2,2-Trifluoroethanol-d{3}, 99% (Isotopic)
CAS: 77253-67-9 Molecular Formula: C2H3F3O Molecular Weight (g/mol): 103.06 MDL Number: MFCD00037682 InChI Key: RHQDFWAXVIIEBN-IDPMSXFZSA-N Synonym: 2,2,2-trifluoroethanol-d3,1,1-2h2-2,2,2-trifluoroetane-1-2h ol,ethan-1,1-d2-ol-d, 2,2,2-trifluoro,trifluoro 2 h? ethan 2 h ol,2,2,2-trifluoroethanol-d3 >98 atom % d,2,2,2-trifluoroethanol-d3, ≥99.5 atom % d,2,2,2-trifluoroethanol-d3, 99 atom % d cp PubChem CID: 2724851 SMILES: [2H]OC([2H])([2H])C(F)(F)F
| PubChem CID | 2724851 |
|---|---|
| CAS | 77253-67-9 |
| Molecular Weight (g/mol) | 103.06 |
| MDL Number | MFCD00037682 |
| SMILES | [2H]OC([2H])([2H])C(F)(F)F |
| Synonym | 2,2,2-trifluoroethanol-d3,1,1-2h2-2,2,2-trifluoroetane-1-2h ol,ethan-1,1-d2-ol-d, 2,2,2-trifluoro,trifluoro 2 h? ethan 2 h ol,2,2,2-trifluoroethanol-d3 >98 atom % d,2,2,2-trifluoroethanol-d3, ≥99.5 atom % d,2,2,2-trifluoroethanol-d3, 99 atom % d cp |
| InChI Key | RHQDFWAXVIIEBN-IDPMSXFZSA-N |
| Molecular Formula | C2H3F3O |
2,2,2-Trifluoroethanol-d{2}, 98% (Isotopic), Thermo Scientific Chemicals
CAS: 132248-58-9 Molecular Formula: C2H3F3O Molecular Weight (g/mol): 102.052 MDL Number: MFCD00082609 InChI Key: RHQDFWAXVIIEBN-DICFDUPASA-N Synonym: 2,2,2-trifluoroethanol-1,1-d2,trifluoroethanol-d2,2,2,2-trifluoroethanol-d2,trifluoro 2 h? ethanol,2,2,2-trifluoroethyl-1,1-d2 alcohol,2 2 2-trifluoroethyl-1 1-d2 alcohol,2,2,2-trifluoroethanol-1,1-d2 99.5 atom % d,2,2,2-trifluoroethanol-1,1-d2, 99.5 atom % d,2 2 2-trifluoroethyl-1 1-d2 alcohol 99.5 PubChem CID: 12255976 IUPAC Name: 1,1-dideuterio-2,2,2-trifluoroethanol SMILES: C(C(F)(F)F)O
| PubChem CID | 12255976 |
|---|---|
| CAS | 132248-58-9 |
| Molecular Weight (g/mol) | 102.052 |
| MDL Number | MFCD00082609 |
| SMILES | C(C(F)(F)F)O |
| Synonym | 2,2,2-trifluoroethanol-1,1-d2,trifluoroethanol-d2,2,2,2-trifluoroethanol-d2,trifluoro 2 h? ethanol,2,2,2-trifluoroethyl-1,1-d2 alcohol,2 2 2-trifluoroethyl-1 1-d2 alcohol,2,2,2-trifluoroethanol-1,1-d2 99.5 atom % d,2,2,2-trifluoroethanol-1,1-d2, 99.5 atom % d,2 2 2-trifluoroethyl-1 1-d2 alcohol 99.5 |
| IUPAC Name | 1,1-dideuterio-2,2,2-trifluoroethanol |
| InChI Key | RHQDFWAXVIIEBN-DICFDUPASA-N |
| Molecular Formula | C2H3F3O |
tert-Butyl methyl ether, HPLC Grade, 99+%
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00008812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | MFCD00008812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
tert-Butyl methyl ether, HPLC grade, 99+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00008812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | MFCD00008812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Dimethyl sulfoxide-d{6}, 99.5% (Isotopic)
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |