Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
| CAS | 8047-15-2 |
|---|---|
| MDL Number | MFCD00081981 |
Ninhydrin, 99%
CAS: 485-47-2 Molecular Formula: C9H6O4 Molecular Weight (g/mol): 178.143 MDL Number: MFCD00003791 InChI Key: FEMOMIGRRWSMCU-UHFFFAOYSA-N Synonym: ninhydrin,ninhydrin hydrate,1,2,3-indantrione monohydrate,ninhydrine,2,2-dihydroxy-1h-indene-1,3 2h-dione,2,2-dihydroxy-1,3-indandione,triketohydrindene hydrate,1h-indene-1,3 2h-dione, 2,2-dihydroxy,1,2,3-indantrione, 2-hydrate,2,2-dihydroxyindane-1,3-dione PubChem CID: 10236 ChEBI: CHEBI:86374 IUPAC Name: 2,2-dihydroxyindene-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O
| PubChem CID | 10236 |
|---|---|
| CAS | 485-47-2 |
| Molecular Weight (g/mol) | 178.143 |
| ChEBI | CHEBI:86374 |
| MDL Number | MFCD00003791 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O |
| Synonym | ninhydrin,ninhydrin hydrate,1,2,3-indantrione monohydrate,ninhydrine,2,2-dihydroxy-1h-indene-1,3 2h-dione,2,2-dihydroxy-1,3-indandione,triketohydrindene hydrate,1h-indene-1,3 2h-dione, 2,2-dihydroxy,1,2,3-indantrione, 2-hydrate,2,2-dihydroxyindane-1,3-dione |
| IUPAC Name | 2,2-dihydroxyindene-1,3-dione |
| InChI Key | FEMOMIGRRWSMCU-UHFFFAOYSA-N |
| Molecular Formula | C9H6O4 |
Triphenylphosphine, 99%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
Vitamin B12, 98+% (dry wt basis)
CAS: 68-19-9 Molecular Formula: C63H89CoN14O14P Molecular Weight (g/mol): 1356.396 MDL Number: MFCD00151092 InChI Key: AGVAZMGAQJOSFJ-WZHZPDAFSA-M Synonym: vitamin b12 PubChem CID: 129893524 IUPAC Name: cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- SMILES: CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=C(C7=NC(=CC8=NC(=C(C4=N5)C)C(C8(C)C)CCC(=O)N)C(C7(C)CC(=O)N)CCC(=O)N)C)[N-]6)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+2]
| PubChem CID | 129893524 |
|---|---|
| CAS | 68-19-9 |
| Molecular Weight (g/mol) | 1356.396 |
| MDL Number | MFCD00151092 |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=C(C7=NC(=CC8=NC(=C(C4=N5)C)C(C8(C)C)CCC(=O)N)C(C7(C)CC(=O)N)CCC(=O)N)C)[N-]6)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+2] |
| Synonym | vitamin b12 |
| IUPAC Name | cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- |
| InChI Key | AGVAZMGAQJOSFJ-WZHZPDAFSA-M |
| Molecular Formula | C63H89CoN14O14P |
Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Polysorbate 20
CAS: 9005-64-5 Molecular Formula: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 Molecular Weight (g/mol): 522.68 MDL Number: MFCD00165986 InChI Key: HMFKFHLTUCJZJO-UHFFFAOYNA-N Synonym: tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf PubChem CID: 443314 IUPAC Name: 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| PubChem CID | 443314 |
|---|---|
| CAS | 9005-64-5 |
| Molecular Weight (g/mol) | 522.68 |
| MDL Number | MFCD00165986 |
| SMILES | CCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Synonym | tween 20,polysorbate 20,polyoxyethylene sorbitan monolaurate,polyoxyethylene 20 sorbitan monolaurate,polysorbate inn,2-2-3,4-bis 2-hydroxyethoxy oxolan-2-yl-2-2-hydroxyethoxy ethoxy ethyl dodecanoate,alkest tw 20,polysorbate 20 nf,polysorbate 40 nf |
| IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate |
| InChI Key | HMFKFHLTUCJZJO-UHFFFAOYNA-N |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC18H34O6 |
Ammonium thiocyanate, 98+%
CAS: 1762-95-4 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.117 MDL Number: MFCD00011428 InChI Key: SOIFLUNRINLCBN-UHFFFAOYSA-N Synonym: ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt PubChem CID: 15666 IUPAC Name: azanium;thiocyanate SMILES: C(#N)[S-].[NH4+]
| PubChem CID | 15666 |
|---|---|
| CAS | 1762-95-4 |
| Molecular Weight (g/mol) | 76.117 |
| MDL Number | MFCD00011428 |
| SMILES | C(#N)[S-].[NH4+] |
| Synonym | ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt |
| IUPAC Name | azanium;thiocyanate |
| InChI Key | SOIFLUNRINLCBN-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
Ethylenediaminetetraacetic Acid Disodium Salt Solution 0.1M (0.2N), NIST Standard Solution ready to use, for volumetric analysis, meets analytical specification of Ph.Eur., BP , Fisher Chemical™
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Benzyl Alcohol, 99%, Pure
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
Silicone oil, for oil baths, usable range from -40 to +200°C
CAS: 63148-62-9 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): NaN MDL Number: MFCD00132673 IUPAC Name: Polydimethylsiloxane SMILES: C[Si](C)(-*)O-*
| CAS | 63148-62-9 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00132673 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | Polydimethylsiloxane |
| Molecular Formula | (C2H6OSi)n |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99%, pure
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Trisodium citrate dihydrate, 99%
CAS: 6132-04-3 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.10 MDL Number: MFCD00150031 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 6132-04-3 |
| Molecular Weight (g/mol) | 294.10 |
| ChEBI | CHEBI:32142 |
| MDL Number | MFCD00150031 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Polyethylene glycol 4,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 4000 IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 4000 |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |