Staining Reagents
Filtered Search Results
Thermo Scientific Chemicals Methylene Blue hydrate, 96+%, high purity biological stain
CAS: 122965-43-9 Molecular Formula: C16H18ClN3S Molecular Weight (g/mol): 319.85 MDL Number: MFCD00150006 InChI Key: CXKWCBBOMKCUKX-UHFFFAOYSA-M Synonym: Basic Blue 9 hydrate,C.I. 52015 hydrate PubChem CID: 16211647 IUPAC Name: [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;hydrate SMILES: [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C
| PubChem CID | 16211647 |
|---|---|
| CAS | 122965-43-9 |
| Molecular Weight (g/mol) | 319.85 |
| MDL Number | MFCD00150006 |
| SMILES | [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C |
| Synonym | Basic Blue 9 hydrate,C.I. 52015 hydrate |
| IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;hydrate |
| InChI Key | CXKWCBBOMKCUKX-UHFFFAOYSA-M |
| Molecular Formula | C16H18ClN3S |
Thermo Scientific™ Gram Stain Kit
Differentiate gram-positive organisms from gram-negative organisms using Gram Stain Kit.
Thermo Scientific Chemicals Methylene Blue, pure, certified, residual water
CAS: 7220-79-3 Molecular Formula: C16H24ClN3O3S Molecular Weight (g/mol): 373.90 MDL Number: MFCD00150008 InChI Key: XQAXGZLFSSPBMK-UHFFFAOYSA-M Synonym: Basic Blue 9 PubChem CID: 6099 ChEBI: CHEBI:6872 IUPAC Name: [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride SMILES: O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C
| PubChem CID | 6099 |
|---|---|
| CAS | 7220-79-3 |
| Molecular Weight (g/mol) | 373.90 |
| ChEBI | CHEBI:6872 |
| MDL Number | MFCD00150008 |
| SMILES | O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C |
| Synonym | Basic Blue 9 |
| IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
| InChI Key | XQAXGZLFSSPBMK-UHFFFAOYSA-M |
| Molecular Formula | C16H24ClN3O3S |
Thermo Scientific Chemicals Alizarin Red S, pure, certified
CAS: 130-22-3 Molecular Formula: C14H7NaO7S Molecular Weight (g/mol): 342.253 MDL Number: MFCD00013049 InChI Key: HFVAFDPGUJEFBQ-UHFFFAOYSA-M Synonym: 9,10-Dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenesulfonic acid, sodium salt,9, 10-Dihydro-3, 4-dihydroxy-9,Mordant Red 3,Sodium alizarinesulfonate PubChem CID: 3955344 ChEBI: CHEBI:87358 IUPAC Name: sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate SMILES: C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+]
| PubChem CID | 3955344 |
|---|---|
| CAS | 130-22-3 |
| Molecular Weight (g/mol) | 342.253 |
| ChEBI | CHEBI:87358 |
| MDL Number | MFCD00013049 |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] |
| Synonym | 9,10-Dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenesulfonic acid, sodium salt,9, 10-Dihydro-3, 4-dihydroxy-9,Mordant Red 3,Sodium alizarinesulfonate |
| IUPAC Name | sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| InChI Key | HFVAFDPGUJEFBQ-UHFFFAOYSA-M |
| Molecular Formula | C14H7NaO7S |
Thermo Scientific Chemicals Methyl Red, pure, indicator
CAS: 493-52-7 Molecular Formula: C15H15N3O2 Molecular Weight (g/mol): 269.304 InChI Key: CEQFOVLGLXCDCX-UHFFFAOYSA-N Synonym: Acid Red 2,2-[4-(Dimethylamino)phenylazo]benzoic acid,C.I. 13020 PubChem CID: 10303 IUPAC Name: 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid SMILES: CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)O
| PubChem CID | 10303 |
|---|---|
| CAS | 493-52-7 |
| Molecular Weight (g/mol) | 269.304 |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)O |
| Synonym | Acid Red 2,2-[4-(Dimethylamino)phenylazo]benzoic acid,C.I. 13020 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid |
| InChI Key | CEQFOVLGLXCDCX-UHFFFAOYSA-N |
| Molecular Formula | C15H15N3O2 |
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-ium chloride hydrate: 1.0%; Water: 99% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00012111 |
| Physical Form | Liquid |
| Solubility Information | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Chemical Name or Material | Methylene Blue |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | C16H18ClN3S |
| Formula Weight | 319.86 |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| Assay Percent Range | 1% w/v aqueous solution |
Thermo Scientific Chemicals Bromocresol Green
CAS: 76-60-8 Molecular Formula: C21H14Br4O5S Molecular Weight (g/mol): 698.014 MDL Number: MFCD00005874 InChI Key: FRPHFZCDPYBUAU-UHFFFAOYSA-N Synonym: Bromcresol Green PubChem CID: 6451 IUPAC Name: 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol SMILES: CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br
| PubChem CID | 6451 |
|---|---|
| CAS | 76-60-8 |
| Molecular Weight (g/mol) | 698.014 |
| MDL Number | MFCD00005874 |
| SMILES | CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br |
| Synonym | Bromcresol Green |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol |
| InChI Key | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
| Molecular Formula | C21H14Br4O5S |
Thermo Scientific Chemicals Bromophenol Blue
CAS: 115-39-9 Molecular Formula: C19H10Br4O5S Molecular Weight (g/mol): 669.96 MDL Number: MFCD00005875 InChI Key: UDSAIICHUKSCKT-UHFFFAOYSA-N Synonym: Bromphenol Blue PubChem CID: 8272 ChEBI: CHEBI:59424 IUPAC Name: 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol SMILES: C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br
| PubChem CID | 8272 |
|---|---|
| CAS | 115-39-9 |
| Molecular Weight (g/mol) | 669.96 |
| ChEBI | CHEBI:59424 |
| MDL Number | MFCD00005875 |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| Synonym | Bromphenol Blue |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| InChI Key | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| Molecular Formula | C19H10Br4O5S |
Thermo Scientific Chemicals Toluidine Blue O, pure
CAS: 92-31-9 Molecular Formula: C15H16ClN3S Molecular Weight (g/mol): 305.82 MDL Number: MFCD00011934 InChI Key: HNONEKILPDHFOL-UHFFFAOYSA-M Synonym: Basic blue 17,C.I. 52040,Tolonium chloride PubChem CID: 7083 SMILES: [Cl-].CN(C)C1=CC=C2N=C3C=C(C)C(N)=CC3=[S+]C2=C1
| PubChem CID | 7083 |
|---|---|
| CAS | 92-31-9 |
| Molecular Weight (g/mol) | 305.82 |
| MDL Number | MFCD00011934 |
| SMILES | [Cl-].CN(C)C1=CC=C2N=C3C=C(C)C(N)=CC3=[S+]C2=C1 |
| Synonym | Basic blue 17,C.I. 52040,Tolonium chloride |
| InChI Key | HNONEKILPDHFOL-UHFFFAOYSA-M |
| Molecular Formula | C15H16ClN3S |
Phenolphthalein Solid, Pure, Indicator Grade, Fisher Chemical™
CAS: 77-09-8 Molecular Formula: C20H14O4 Molecular Weight (g/mol): 318.33 MDL Number: MFCD00005913 InChI Key: KJFMBFZCATUALV-UHFFFAOYSA-N PubChem CID: 4764 ChEBI: CHEBI:34914 IUPAC Name: 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one SMILES: OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1
| PubChem CID | 4764 |
|---|---|
| CAS | 77-09-8 |
| Molecular Weight (g/mol) | 318.33 |
| ChEBI | CHEBI:34914 |
| MDL Number | MFCD00005913 |
| SMILES | OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| IUPAC Name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| Molecular Formula | C20H14O4 |
Thermo Scientific Chemicals Methyl Red, ACS reagent
CAS: 493-52-7 Molecular Formula: C15H15N3O2 Molecular Weight (g/mol): 269.304 MDL Number: MFCD00002425 InChI Key: CEQFOVLGLXCDCX-UHFFFAOYSA-N Synonym: Acid Red 2,2-[4-(Dimethylamino)phenylazo]benzoic acid,C.I. 13020 PubChem CID: 10303 IUPAC Name: 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid SMILES: CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)O
| PubChem CID | 10303 |
|---|---|
| CAS | 493-52-7 |
| Molecular Weight (g/mol) | 269.304 |
| MDL Number | MFCD00002425 |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)O |
| Synonym | Acid Red 2,2-[4-(Dimethylamino)phenylazo]benzoic acid,C.I. 13020 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid |
| InChI Key | CEQFOVLGLXCDCX-UHFFFAOYSA-N |
| Molecular Formula | C15H15N3O2 |
Thermo Scientific Chemicals Fluorescein, disodium salt, pure
CAS: 518-47-8 Molecular Formula: C20H10Na2O5 Molecular Weight (g/mol): 376.28 MDL Number: MFCD00167039 InChI Key: NJDNXYGOVLYJHP-UHFFFAOYSA-L IUPAC Name: disodium 2-(6-oxido-3-oxo-3H-xanthen-9-yl)benzoate SMILES: [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C12
| CAS | 518-47-8 |
|---|---|
| Molecular Weight (g/mol) | 376.28 |
| MDL Number | MFCD00167039 |
| SMILES | [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C12 |
| IUPAC Name | disodium 2-(6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| InChI Key | NJDNXYGOVLYJHP-UHFFFAOYSA-L |
| Molecular Formula | C20H10Na2O5 |
Ninhydrin Monohydrate, Extra Pure, Fisher Chemical™
CAS: 485-47-2 Molecular Formula: C9H6O4 Molecular Weight (g/mol): 178.143 MDL Number: 3791 InChI Key: FEMOMIGRRWSMCU-UHFFFAOYSA-N PubChem CID: 10236 ChEBI: CHEBI:86374 IUPAC Name: 2,2-dihydroxyindene-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O
| PubChem CID | 10236 |
|---|---|
| CAS | 485-47-2 |
| Molecular Weight (g/mol) | 178.143 |
| ChEBI | CHEBI:86374 |
| MDL Number | 3791 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O |
| IUPAC Name | 2,2-dihydroxyindene-1,3-dione |
| InChI Key | FEMOMIGRRWSMCU-UHFFFAOYSA-N |
| Molecular Formula | C9H6O4 |
| CAS | 122965-43-9 |
|---|
Crystal Violet, Fisher Chemical™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More