Learn More
Amikacin (From Kanamycin A, White Crystalline Powder), Fisher BioReagents
Brand: Fisher Bioreagents BP2643-1
Additional Details : CAS : 37517-28-5 Weight : 0.05100kg
| Packaging | Amber Glass |
|---|---|
| Quantity | 1g |
Description
- An antibiotic that serves as a selective agent to isolate transformed bacteria
- Amikacin functions as an indirect inhibitor of protein synthesis in prokaryotes by binding to the 30S subunit of ribosomes
- Useful as a selective agent to isolate bacteria that have been transformed with plasmid containing the antibiotic-resistant gene
- Intended for research purposes only; not for manufacturing or commercial use
Chemical Identifiers
| 37517-28-5 | |
| 585.608 | |
| Lukadin | |
| CHEBI:2637 | |
| C1C(C(C(C(C1NC(=O)C(CCN)O)OC2C(C(C(C(O2)CO)O)N)O)O)OC3C(C(C(C(O3)CN)O)O)O)N |
| C22H43N5O13 | |
| LKCWBDHBTVXHDL-RMDFUYIESA-N | |
| 37768 | |
| (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxybutanamide |
Specifications
| Amikacin | |
| 37517-28-5 | |
| Pass Test | |
| 15, 400 | |
| Lukadin | |
| > 900μg/mg | |
| (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxybutanamide | |
| 37768 | |
| 585.61 | |
| completely soluble in water | |
| 214°C | |
| 1g |
| From Kanamycin A | |
| Pass Test | |
| C22H43N5O13 | |
| Amber Glass | |
| LKCWBDHBTVXHDL-RMDFUYIESA-N | |
| C1C(C(C(C(C1NC(=O)C(CCN)O)OC2C(C(C(C(O2)CO)O)N)O)O)OC3C(C(C(C(O3)CN)O)O)O)N | |
| 585.608 | |
| CHEBI:2637 | |
| Solid | |
| White | |
| 9.5 to 11.5 |