Isotopically Labeled Compounds
- (73)
- (6)
- (2)
- (1)
- (2)
- (24)
- (3)
- (2)
- (2)
- (2)
- (1)
- (4)
- (9)
- (2)
- (2)
- (10)
- (1)
- (6)
- (3)
- (1)
- (10)
- (10)
- (1)
- (2)
- (11)
- (3)
- (8)
- (7)
- (5)
- (6)
Filtered Search Results
Chloroform-d, for NMR, 99.8 atom % D
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 99.8 atom % D, stabilized with silver foil
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 99.8 atom % D, contains 1 v/v% TMS
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 100.0 atom % D
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 99.8+ atom % D, contains 0.02-0.04 v/v% TMS
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 99.8+% D, stab. with Ag foil, 0.02-0.04 v/v% TMS
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 99.8% D, stabilized with silver foil, 1 v/v% TMS
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Chloroform-d, for NMR, 99.6+ atom % D
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Pyridine-d5, for NMR, 100.0 atom % D
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
Iodomethane-d3, for NMR, 99+ atom % D
CAS: 865-50-9 Molecular Formula: CH3I Molecular Weight (g/mol): 144.96 MDL Number: MFCD00001074 InChI Key: INQOMBQAUSQDDS-FIBGUPNXSA-N Synonym: iodomethane-d3,iodo 2h3 methane,trideuterio iodo methane,iodo 2 h? methane,methyl-d3 iodide,trideuteromethyl iodide,iodomethane-12c,d3,methyl-12c,d3 iodide,iodoethane-d5 ethyliodid-d5,methyl iodide d3 stored over copper PubChem CID: 2723978 IUPAC Name: trideuterio(iodo)methane SMILES: [2H]C([2H])([2H])I
| PubChem CID | 2723978 |
|---|---|
| CAS | 865-50-9 |
| Molecular Weight (g/mol) | 144.96 |
| MDL Number | MFCD00001074 |
| SMILES | [2H]C([2H])([2H])I |
| Synonym | iodomethane-d3,iodo 2h3 methane,trideuterio iodo methane,iodo 2 h? methane,methyl-d3 iodide,trideuteromethyl iodide,iodomethane-12c,d3,methyl-12c,d3 iodide,iodoethane-d5 ethyliodid-d5,methyl iodide d3 stored over copper |
| IUPAC Name | trideuterio(iodo)methane |
| InChI Key | INQOMBQAUSQDDS-FIBGUPNXSA-N |
| Molecular Formula | CH3I |
Naphthalene-d8, for NMR, 98+ atom % D
CAS: 1146-65-2 Molecular Formula: C10H8 Molecular Weight (g/mol): 136.22 MDL Number: MFCD00001743 InChI Key: UFWIBTONFRDIAS-PGRXLJNUSA-N Synonym: naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane PubChem CID: 92148 IUPAC Name: 1,2,3,4,5,6,7,8-octadeuterionaphthalene SMILES: [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H]
| PubChem CID | 92148 |
|---|---|
| CAS | 1146-65-2 |
| Molecular Weight (g/mol) | 136.22 |
| MDL Number | MFCD00001743 |
| SMILES | [2H]C1=C([2H])C2=C([2H])C([2H])=C([2H])C([2H])=C2C([2H])=C1[2H] |
| Synonym | naphthalene-d8,2h8 naphthalene,perdeuteronaphthalene,naphthalene d8,perdeuterated naphthalene,2 h? naphthalene,naphthalene-d8, analytical standard,naphthalene-d8 >98.0 atom % d,naphthalene d8 10 microg/ml in cyclohexane |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterionaphthalene |
| InChI Key | UFWIBTONFRDIAS-PGRXLJNUSA-N |
| Molecular Formula | C10H8 |
1,1,2,2-Tetrachloroethane-d2, for NMR, 99 atom % D
CAS: 33685-54-0 Molecular Formula: C2H2Cl4 Molecular Weight (g/mol): 169.85 MDL Number: MFCD00037672 InChI Key: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d PubChem CID: 118531 IUPAC Name: 1,1,2,2-tetrachloro-1,2-dideuterioethane SMILES: C(C(Cl)Cl)(Cl)Cl
| PubChem CID | 118531 |
|---|---|
| CAS | 33685-54-0 |
| Molecular Weight (g/mol) | 169.85 |
| MDL Number | MFCD00037672 |
| SMILES | C(C(Cl)Cl)(Cl)Cl |
| Synonym | 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d |
| IUPAC Name | 1,1,2,2-tetrachloro-1,2-dideuterioethane |
| InChI Key | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| Molecular Formula | C2H2Cl4 |
Pyridine-d5, for NMR, 99 atom % D
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
n-Hexane-d14, for NMR, 99+ atom % D
CAS: 21666-38-6 Molecular Formula: C6H14 Molecular Weight (g/mol): 100.26 MDL Number: MFCD00037562 InChI Key: VLKZOEOYAKHREP-ZLKPZJALSA-N Synonym: hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d PubChem CID: 140854 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 140854 |
|---|---|
| CAS | 21666-38-6 |
| Molecular Weight (g/mol) | 100.26 |
| MDL Number | MFCD00037562 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Synonym | hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChI Key | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| Molecular Formula | C6H14 |