Resins and Supports
Filtered Search Results
| CAS | 9049-93-8 |
|---|---|
| MDL Number | MFCD00145842 |
Amberlyst™ 15, (dry) ion-exchange resin
CAS: 9037-24-5 Molecular Formula: MFCD00145841 Molecular Weight (g/mol): 0.00 MDL Number: MFCD00145841 InChI Key: YZUPZGFPHUVJKC-UHFFFAOYSA-N PubChem CID: 80972 SMILES: *
| PubChem CID | 80972 |
|---|---|
| CAS | 9037-24-5 |
| Molecular Weight (g/mol) | 0.00 |
| MDL Number | MFCD00145841 |
| SMILES | * |
| InChI Key | YZUPZGFPHUVJKC-UHFFFAOYSA-N |
| Molecular Formula | MFCD00145841 |
Amberlyst™ 15(H), ion exchange resin
CAS: 39389-20-3 Molecular Formula: C18H18O3S Molecular Weight (g/mol): 314.399 MDL Number: MFCD00145841 InChI Key: SIWVGXQOXWGJCI-UHFFFAOYSA-N Synonym: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 IUPAC Name: 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
| PubChem CID | 170197 |
|---|---|
| CAS | 39389-20-3 |
| Molecular Weight (g/mol) | 314.399 |
| MDL Number | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Synonym | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-ethenylbenzenesulfonic acid |
| InChI Key | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| Molecular Formula | C18H18O3S |
| CAS | 104219-63-8 |
|---|---|
| MDL Number | MFCD00145831 |
Dowtherm™ A
CAS: 8004-13-5 Molecular Formula: C24H20O Molecular Weight (g/mol): 324.423 MDL Number: MFCD00148859 InChI Key: MHCVCKDNQYMGEX-UHFFFAOYSA-N Synonym: diphyl,dowtherm,dowtherm a,dinil,dinyl,therminol vp,phenyl ether-biphenyl mixture,phenyl ether-diphenyl mixture,biphenyl-diphenyl ether mixture,hsdb 137 PubChem CID: 24670 IUPAC Name: 1,1'-biphenyl;phenoxybenzene SMILES: C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 24670 |
|---|---|
| CAS | 8004-13-5 |
| Molecular Weight (g/mol) | 324.423 |
| MDL Number | MFCD00148859 |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2.C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphyl,dowtherm,dowtherm a,dinil,dinyl,therminol vp,phenyl ether-biphenyl mixture,phenyl ether-diphenyl mixture,biphenyl-diphenyl ether mixture,hsdb 137 |
| IUPAC Name | 1,1'-biphenyl;phenoxybenzene |
| InChI Key | MHCVCKDNQYMGEX-UHFFFAOYSA-N |
| Molecular Formula | C24H20O |
AmberChrom™ 1X8 200-400 (Cl)
CAS: 12627-85-9 Molecular Formula: C29H34ClN Molecular Weight (g/mol): 432.05 MDL Number: MFCD00132718 InChI Key: BBQMUEOYPPPODD-UHFFFAOYSA-M Synonym: dowex 1x2 50-100 cl,dowex 1x8 50-100 cl PubChem CID: 16212807 SMILES: *
| PubChem CID | 16212807 |
|---|---|
| CAS | 12627-85-9 |
| Molecular Weight (g/mol) | 432.05 |
| MDL Number | MFCD00132718 |
| SMILES | * |
| Synonym | dowex 1x2 50-100 cl,dowex 1x8 50-100 cl |
| InChI Key | BBQMUEOYPPPODD-UHFFFAOYSA-M |
| Molecular Formula | C29H34ClN |
AmberChrom™ 1X8 100-200 (Cl)
CAS: 12627-85-9 Molecular Formula: C29H34ClN Molecular Weight (g/mol): 432.05 MDL Number: MFCD00132718 InChI Key: BBQMUEOYPPPODD-UHFFFAOYSA-M Synonym: dowex 1x2 50-100 cl,dowex 1x8 50-100 cl PubChem CID: 16212807 IUPAC Name: 1,4-diethenylbenzene 4-ethenyl-N,N,N-trimethylanilinium ethenylbenzene chloride SMILES: *
| PubChem CID | 16212807 |
|---|---|
| CAS | 12627-85-9 |
| Molecular Weight (g/mol) | 432.05 |
| MDL Number | MFCD00132718 |
| SMILES | * |
| Synonym | dowex 1x2 50-100 cl,dowex 1x8 50-100 cl |
| IUPAC Name | 1,4-diethenylbenzene 4-ethenyl-N,N,N-trimethylanilinium ethenylbenzene chloride |
| InChI Key | BBQMUEOYPPPODD-UHFFFAOYSA-M |
| Molecular Formula | C29H34ClN |
Amberlite™ IRA-900(Cl), ion exchange resin
CAS: 9050-97-9 Molecular Formula: C4H12ClN Molecular Weight (g/mol): 109.60 MDL Number: MFCD00132712 InChI Key: OKIZCWYLBDKLSU-UHFFFAOYSA-M Synonym: tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl PubChem CID: 6379 ChEBI: CHEBI:7070 IUPAC Name: tetramethylazanium chloride SMILES: [Cl-].C[N+](C)(C)C
| PubChem CID | 6379 |
|---|---|
| CAS | 9050-97-9 |
| Molecular Weight (g/mol) | 109.60 |
| ChEBI | CHEBI:7070 |
| MDL Number | MFCD00132712 |
| SMILES | [Cl-].C[N+](C)(C)C |
| Synonym | tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl |
| IUPAC Name | tetramethylazanium chloride |
| InChI Key | OKIZCWYLBDKLSU-UHFFFAOYSA-M |
| Molecular Formula | C4H12ClN |
Amberlite™ IRA-900, Cl-form, ion-exchange resin
CAS: 9050-97-9 Molecular Formula: C4H12ClN Molecular Weight (g/mol): 109.60 MDL Number: MFCD00132712 InChI Key: OKIZCWYLBDKLSU-UHFFFAOYSA-M Synonym: tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl PubChem CID: 6379 ChEBI: CHEBI:7070 SMILES: [Cl-].C[N+](C)(C)C
| PubChem CID | 6379 |
|---|---|
| CAS | 9050-97-9 |
| Molecular Weight (g/mol) | 109.60 |
| ChEBI | CHEBI:7070 |
| MDL Number | MFCD00132712 |
| SMILES | [Cl-].C[N+](C)(C)C |
| Synonym | tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl |
| InChI Key | OKIZCWYLBDKLSU-UHFFFAOYSA-M |
| Molecular Formula | C4H12ClN |
AmberChrom 1x2 50-100 (Cl)
CAS: 9085-42-1 Molecular Formula: C29H34ClN Molecular Weight (g/mol): 432.05 MDL Number: MFCD00132715 InChI Key: BBQMUEOYPPPODD-UHFFFAOYSA-M Synonym: dowex 1x2 50-100 cl,dowex 1x8 50-100 cl PubChem CID: 16212807 SMILES: [Cl-].C=CC1=CC=CC=C1.C=CC1=CC=C(C=C)C=C1.C[N+](C)(C)C1=CC=C(C=C)C=C1
| PubChem CID | 16212807 |
|---|---|
| CAS | 9085-42-1 |
| Molecular Weight (g/mol) | 432.05 |
| MDL Number | MFCD00132715 |
| SMILES | [Cl-].C=CC1=CC=CC=C1.C=CC1=CC=C(C=C)C=C1.C[N+](C)(C)C1=CC=C(C=C)C=C1 |
| Synonym | dowex 1x2 50-100 cl,dowex 1x8 50-100 cl |
| InChI Key | BBQMUEOYPPPODD-UHFFFAOYSA-M |
| Molecular Formula | C29H34ClN |
Polycarbonate resin, approx. M.W. 45.000, pellets
CAS: 24936-68-3 Molecular Formula: (C16H14O3)n Molecular Weight (g/mol): NaN MDL Number: MFCD00084476 SMILES: CC(C)(C1=CC=C(-*)C=C1)C1=CC=C(OC(=O)O-*)C=C1
| CAS | 24936-68-3 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00084476 |
| SMILES | CC(C)(C1=CC=C(-*)C=C1)C1=CC=C(OC(=O)O-*)C=C1 |
| Molecular Formula | (C16H14O3)n |
Triphenylphosphine resin, 1% crossl. with DVB, 1.0-1.5 mmol/g, 100-200 mesh
CAS: 39319-11-4 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 39319-11-4 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |