Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
| Linear Formula | Na2S2O3 |
|---|---|
| Molecular Weight (g/mol) | 158.10 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Sodium thiosulfate |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Merck Index | 15, 8821 |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| PubChem CID | 24477 |
| Concentration or Composition (by Analyte or Components) | 0.0950 to 0.1050N (20°C) |
| CAS | 7732-18-5 |
| MDL Number | MFCD00003499 |
| Health Hazard 1 | |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| Molecular Formula | Na2O3S2 |
| Formula Weight | 158.11 |
Sodium benzyloxide, 1M solution in benzyl alcohol, AcroSeal™
CAS: 20194-18-7 | C7H7NaO | 130.12 g/mol
N,N'-Bis(trimethylsilyl)urea, 98+%
CAS: 18297-63-7 Molecular Formula: C7H20N2OSi2 Molecular Weight (g/mol): 204.42 MDL Number: MFCD00008260 InChI Key: MASDFXZJIDNRTR-UHFFFAOYSA-N Synonym: 1,3-bis trimethylsilyl urea,n,n'-bis trimethylsilyl urea,bis trimethylsilyl urea,urea, n,n'-bis trimethylsilyl,n,n'-bis-trimethylsilyl-urea,urea, 1,3-bis trimethylsilyl,bsu,urea, bis-tms,hexamethyl disilaurea PubChem CID: 87562 IUPAC Name: 1,3-bis(trimethylsilyl)urea SMILES: C[Si](C)(C)NC(=O)N[Si](C)(C)C
| PubChem CID | 87562 |
|---|---|
| CAS | 18297-63-7 |
| Molecular Weight (g/mol) | 204.42 |
| MDL Number | MFCD00008260 |
| SMILES | C[Si](C)(C)NC(=O)N[Si](C)(C)C |
| Synonym | 1,3-bis trimethylsilyl urea,n,n'-bis trimethylsilyl urea,bis trimethylsilyl urea,urea, n,n'-bis trimethylsilyl,n,n'-bis-trimethylsilyl-urea,urea, 1,3-bis trimethylsilyl,bsu,urea, bis-tms,hexamethyl disilaurea |
| IUPAC Name | 1,3-bis(trimethylsilyl)urea |
| InChI Key | MASDFXZJIDNRTR-UHFFFAOYSA-N |
| Molecular Formula | C7H20N2OSi2 |
| Linear Formula | AgNO3 |
|---|---|
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Density | 1.0150g/mL |
| PubChem CID | 24470 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 01,1008; 02,366; 03,252; 04,429; 05,582; 07,321; 09,411; 10,350; 11,268; 12,257; 14,350; 15,39 |
| Formula Weight | 169.87 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Silver nitrate |
| Grade | Pure |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Merck Index | 15, 8657 |
| Concentration or Composition (by Analyte or Components) | 0.0998 to 0.1002N (20°C) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. If skin irritation occurs: Get medical advice/attention. IF IN EYES: Rinse cautiously with wa |
| MDL Number | MFCD00003414 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Causes skin irritation. Causes serious eye irritation. Very toxic to aquatic life with long lasting effects. |
| Packaging | HDPE Bottle |
| Solubility Information | Solubility in water: miscible. |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| Molecular Formula | AgNO3 |
| EINECS Number | 231-853-9 |
| Specific Gravity | 1.015 |
| CAS | 7681-11-0 |
|---|
Thermo Scientific Chemicals N,N-Dimethylglycine hydrochloride, 99%
CAS: 2491-06-7 Molecular Formula: C4H9NO2·HCl Molecular Weight (g/mol): 139.58 MDL Number: MFCD00012610 InChI Key: FKASAVXZZLJTNX-UHFFFAOYSA-N Synonym: n,n-dimethylglycine hydrochloride,dimethylglycine hydrochloride,glycine, n,n-dimethyl-, hydrochloride,n-methylsarcosine hydrochloride,n,n-dimethylglycine hcl,dimethylamino acetic acid hydrochloride,unii-yxk75eae92,yxk75eae92,n,n-dimethylaminoacetic acid hydrochloride,2-dimethylamino acetic acid hydrochloride PubChem CID: 75605 IUPAC Name: 2-(dimethylamino)acetic acid;hydrochloride SMILES: CN(C)CC(=O)O.Cl
| PubChem CID | 75605 |
|---|---|
| CAS | 2491-06-7 |
| Molecular Weight (g/mol) | 139.58 |
| MDL Number | MFCD00012610 |
| SMILES | CN(C)CC(=O)O.Cl |
| Synonym | n,n-dimethylglycine hydrochloride,dimethylglycine hydrochloride,glycine, n,n-dimethyl-, hydrochloride,n-methylsarcosine hydrochloride,n,n-dimethylglycine hcl,dimethylamino acetic acid hydrochloride,unii-yxk75eae92,yxk75eae92,n,n-dimethylaminoacetic acid hydrochloride,2-dimethylamino acetic acid hydrochloride |
| IUPAC Name | 2-(dimethylamino)acetic acid;hydrochloride |
| InChI Key | FKASAVXZZLJTNX-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO2·HCl |
N-Methyl-N-trimethylsilylacetamide, 98%
CAS: 7449-74-3 Molecular Formula: C6H15NOSi Molecular Weight (g/mol): 145.277 MDL Number: MFCD00040758 InChI Key: QHUOBLDKFGCVCG-UHFFFAOYSA-N Synonym: n-methyl-n-trimethylsilyl acetamide,acetamide, n-methyl-n-trimethylsilyl,n-trimethylsilyl-n-methylacetamide,n-methyl-n-tms-acetamide,acmc-1bei6,qhuobldkfgcvcg-uhfffaoysa,n-methylacetamide, tms derivative,n-methyl-n-trimethylsilylacetamide, for gc derivatization gc PubChem CID: 81953 IUPAC Name: N-methyl-N-trimethylsilylacetamide SMILES: CC(=O)N(C)[Si](C)(C)C
| PubChem CID | 81953 |
|---|---|
| CAS | 7449-74-3 |
| Molecular Weight (g/mol) | 145.277 |
| MDL Number | MFCD00040758 |
| SMILES | CC(=O)N(C)[Si](C)(C)C |
| Synonym | n-methyl-n-trimethylsilyl acetamide,acetamide, n-methyl-n-trimethylsilyl,n-trimethylsilyl-n-methylacetamide,n-methyl-n-tms-acetamide,acmc-1bei6,qhuobldkfgcvcg-uhfffaoysa,n-methylacetamide, tms derivative,n-methyl-n-trimethylsilylacetamide, for gc derivatization gc |
| IUPAC Name | N-methyl-N-trimethylsilylacetamide |
| InChI Key | QHUOBLDKFGCVCG-UHFFFAOYSA-N |
| Molecular Formula | C6H15NOSi |
n-Hexyltriethoxysilane, 97%
CAS: 18166-37-5 Molecular Formula: C12H28O3Si Molecular Weight (g/mol): 248.44 MDL Number: MFCD00087744 InChI Key: WUMSTCDLAYQDNO-UHFFFAOYSA-N Synonym: hexyltriethoxysilane,triethoxy hexyl silane,hexyl triethoxysilane,n-hexyltriethoxysilane,hexyl-triethoxysilane,acmc-209ei3 PubChem CID: 4437318 IUPAC Name: triethoxy(hexyl)silane SMILES: CCCCCC[Si](OCC)(OCC)OCC
| PubChem CID | 4437318 |
|---|---|
| CAS | 18166-37-5 |
| Molecular Weight (g/mol) | 248.44 |
| MDL Number | MFCD00087744 |
| SMILES | CCCCCC[Si](OCC)(OCC)OCC |
| Synonym | hexyltriethoxysilane,triethoxy hexyl silane,hexyl triethoxysilane,n-hexyltriethoxysilane,hexyl-triethoxysilane,acmc-209ei3 |
| IUPAC Name | triethoxy(hexyl)silane |
| InChI Key | WUMSTCDLAYQDNO-UHFFFAOYSA-N |
| Molecular Formula | C12H28O3Si |
Tetra-n-butylammonium hexafluorophosphate, 98%
CAS: 3109-63-5 Molecular Formula: C16H36F6NP Molecular Weight (g/mol): 387.44 MDL Number: MFCD00011748 InChI Key: BKBKEFQIOUYLBC-UHFFFAOYSA-N Synonym: tetrabutylammonium hexafluorophosphate,tetra-n-butylammonium hexafluorophosphate,tetrabutylammonium hexafluorophosphate v,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-1:1,acmc-1ahjo,n,n,n-tributyl-1-butanaminium hexafluorophosphate,ksc225q6r,tetrabutylammoniumhexafluorophosphate,tetrabutylazanium hexafluorophosphate PubChem CID: 165075 IUPAC Name: tetrabutylazanium;hexafluorophosphate SMILES: F[P-](F)(F)(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 165075 |
|---|---|
| CAS | 3109-63-5 |
| Molecular Weight (g/mol) | 387.44 |
| MDL Number | MFCD00011748 |
| SMILES | F[P-](F)(F)(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hexafluorophosphate,tetra-n-butylammonium hexafluorophosphate,tetrabutylammonium hexafluorophosphate v,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-,1-butanaminium, n,n,n-tributyl-, hexafluorophosphate 1-1:1,acmc-1ahjo,n,n,n-tributyl-1-butanaminium hexafluorophosphate,ksc225q6r,tetrabutylammoniumhexafluorophosphate,tetrabutylazanium hexafluorophosphate |
| IUPAC Name | tetrabutylazanium;hexafluorophosphate |
| InChI Key | BKBKEFQIOUYLBC-UHFFFAOYSA-N |
| Molecular Formula | C16H36F6NP |
n-Propyltrimethoxysilane, 98+%
CAS: 1067-25-0 Molecular Formula: C6H16O3Si Molecular Weight (g/mol): 164.28 MDL Number: MFCD00043026 InChI Key: HQYALQRYBUJWDH-UHFFFAOYSA-N Synonym: trimethoxy propyl silane,n-propyltrimethoxysilane,propyltrimethoxysilane,silane, trimethoxypropyl,unii-t72c7n9xo2,dynasylan ptmo,trimethoxysilylpropane,propyl-trimethoxysilane,silane,trimethoxypropyl,trimethoxy-n-propylsilane PubChem CID: 61254 IUPAC Name: trimethoxy(propyl)silane SMILES: CCC[Si](OC)(OC)OC
| PubChem CID | 61254 |
|---|---|
| CAS | 1067-25-0 |
| Molecular Weight (g/mol) | 164.28 |
| MDL Number | MFCD00043026 |
| SMILES | CCC[Si](OC)(OC)OC |
| Synonym | trimethoxy propyl silane,n-propyltrimethoxysilane,propyltrimethoxysilane,silane, trimethoxypropyl,unii-t72c7n9xo2,dynasylan ptmo,trimethoxysilylpropane,propyl-trimethoxysilane,silane,trimethoxypropyl,trimethoxy-n-propylsilane |
| IUPAC Name | trimethoxy(propyl)silane |
| InChI Key | HQYALQRYBUJWDH-UHFFFAOYSA-N |
| Molecular Formula | C6H16O3Si |
n-Decyltrichlorosilane, 97%
CAS: 13829-21-5 Molecular Formula: C10H21Cl3Si Molecular Weight (g/mol): 275.713 MDL Number: MFCD00013600 InChI Key: HLWCOIUDOLYBGD-UHFFFAOYSA-N Synonym: decyltrichlorosilane,trichloro decyl silane,n-decyltrichlorosilane,silane, trichlorodecyl,acmc-209chi,trichloro n-decyl silane,trichloro decyl silane # PubChem CID: 83764 IUPAC Name: trichloro(decyl)silane SMILES: CCCCCCCCCC[Si](Cl)(Cl)Cl
| PubChem CID | 83764 |
|---|---|
| CAS | 13829-21-5 |
| Molecular Weight (g/mol) | 275.713 |
| MDL Number | MFCD00013600 |
| SMILES | CCCCCCCCCC[Si](Cl)(Cl)Cl |
| Synonym | decyltrichlorosilane,trichloro decyl silane,n-decyltrichlorosilane,silane, trichlorodecyl,acmc-209chi,trichloro n-decyl silane,trichloro decyl silane # |
| IUPAC Name | trichloro(decyl)silane |
| InChI Key | HLWCOIUDOLYBGD-UHFFFAOYSA-N |
| Molecular Formula | C10H21Cl3Si |
Tetra-n-butoxysilane, 97%
CAS: 4766-57-8 Molecular Formula: C16H36O4Si Molecular Weight (g/mol): 320.545 MDL Number: MFCD00009432 InChI Key: UQMOLLPKNHFRAC-UHFFFAOYSA-N Synonym: tetrabutyl orthosilicate,tetrabutoxysilane,tetra-n-butoxysilane,silane, tetrabutoxy,silicon tetrabutoxide,butyl silicate buo 4si,silicic acid h4sio4 , tetrabutyl ester,butyl silicate c4h9o 4si,butyl silicate,tetrabutyl orthosilice PubChem CID: 78500 IUPAC Name: tetrabutyl silicate SMILES: CCCCO[Si](OCCCC)(OCCCC)OCCCC
| PubChem CID | 78500 |
|---|---|
| CAS | 4766-57-8 |
| Molecular Weight (g/mol) | 320.545 |
| MDL Number | MFCD00009432 |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)OCCCC |
| Synonym | tetrabutyl orthosilicate,tetrabutoxysilane,tetra-n-butoxysilane,silane, tetrabutoxy,silicon tetrabutoxide,butyl silicate buo 4si,silicic acid h4sio4 , tetrabutyl ester,butyl silicate c4h9o 4si,butyl silicate,tetrabutyl orthosilice |
| IUPAC Name | tetrabutyl silicate |
| InChI Key | UQMOLLPKNHFRAC-UHFFFAOYSA-N |
| Molecular Formula | C16H36O4Si |
n-Dodecyltrimethoxysilane, 95%
CAS: 3069-21-4 Molecular Formula: C15H34O3Si Molecular Weight (g/mol): 290.52 MDL Number: MFCD00069148 InChI Key: SCPWMSBAGXEGPW-UHFFFAOYSA-N Synonym: n-dodecyltrimethoxysilane,silane, dodecyltrimethoxy,lauryltrimethoxysilane,dodecyl trimethoxy silane,n-dodecytrimethoxysilane,acmc-1cr18,ksc494k8f PubChem CID: 76479 IUPAC Name: dodecyl(trimethoxy)silane SMILES: CCCCCCCCCCCC[Si](OC)(OC)OC
| PubChem CID | 76479 |
|---|---|
| CAS | 3069-21-4 |
| Molecular Weight (g/mol) | 290.52 |
| MDL Number | MFCD00069148 |
| SMILES | CCCCCCCCCCCC[Si](OC)(OC)OC |
| Synonym | n-dodecyltrimethoxysilane,silane, dodecyltrimethoxy,lauryltrimethoxysilane,dodecyl trimethoxy silane,n-dodecytrimethoxysilane,acmc-1cr18,ksc494k8f |
| IUPAC Name | dodecyl(trimethoxy)silane |
| InChI Key | SCPWMSBAGXEGPW-UHFFFAOYSA-N |
| Molecular Formula | C15H34O3Si |
n-Octyltriethoxysilane, 95%
CAS: 2943-75-1 Molecular Formula: C14H32O3Si Molecular Weight (g/mol): 276.49 MDL Number: MFCD00039883 InChI Key: MSRJTTSHWYDFIU-UHFFFAOYSA-N Synonym: n-octyltriethoxysilane,octyltriethoxysilane,triethoxy octyl silane,silane, triethoxyoctyl,dynasylan octeo,octyl triethoxy silane,prosil 9202,silquest a 137,prosil 9234,a 137 coupling agent PubChem CID: 76262 IUPAC Name: triethoxy(octyl)silane SMILES: CCCCCCCC[Si](OCC)(OCC)OCC
| PubChem CID | 76262 |
|---|---|
| CAS | 2943-75-1 |
| Molecular Weight (g/mol) | 276.49 |
| MDL Number | MFCD00039883 |
| SMILES | CCCCCCCC[Si](OCC)(OCC)OCC |
| Synonym | n-octyltriethoxysilane,octyltriethoxysilane,triethoxy octyl silane,silane, triethoxyoctyl,dynasylan octeo,octyl triethoxy silane,prosil 9202,silquest a 137,prosil 9234,a 137 coupling agent |
| IUPAC Name | triethoxy(octyl)silane |
| InChI Key | MSRJTTSHWYDFIU-UHFFFAOYSA-N |
| Molecular Formula | C14H32O3Si |
n-Butyldimethylchlorosilane, 96%
CAS: 1000-50-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.72 MDL Number: MFCD00015727 InChI Key: MXOSTENCGSDMRE-UHFFFAOYSA-N Synonym: butylchlorodimethylsilane,butyldimethylchlorosilane,n-butyldimethylchlorosilane,butyldimethylsilyl chloride,1-butyldimethylchlorosilane,silane, butylchlorodimethyl,butyl chloro dimethylsilane,n-butyl-dimethylchlorosilane,butyl-chloro-dimethyl-silane,n-butyldimethylsilyl chloride PubChem CID: 66079 SMILES: CCCC[Si](C)(C)Cl
| PubChem CID | 66079 |
|---|---|
| CAS | 1000-50-6 |
| Molecular Weight (g/mol) | 150.72 |
| MDL Number | MFCD00015727 |
| SMILES | CCCC[Si](C)(C)Cl |
| Synonym | butylchlorodimethylsilane,butyldimethylchlorosilane,n-butyldimethylchlorosilane,butyldimethylsilyl chloride,1-butyldimethylchlorosilane,silane, butylchlorodimethyl,butyl chloro dimethylsilane,n-butyl-dimethylchlorosilane,butyl-chloro-dimethyl-silane,n-butyldimethylsilyl chloride |
| InChI Key | MXOSTENCGSDMRE-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |