Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Gallium metal, packaged in poylethylene bottle, 99.999% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
Gallium metal, packaged in polyethylene bottle, 99.9% (metals basis)
CAS: 7440-55-3 Molecular Formula: Ga Molecular Weight (g/mol): 69.72 MDL Number: MFCD00134045 InChI Key: GYHNNYVSQQEPJS-UHFFFAOYSA-N Synonym: gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom PubChem CID: 5360835 ChEBI: CHEBI:49631 IUPAC Name: gallium SMILES: [Ga]
| PubChem CID | 5360835 |
|---|---|
| CAS | 7440-55-3 |
| Molecular Weight (g/mol) | 69.72 |
| ChEBI | CHEBI:49631 |
| MDL Number | MFCD00134045 |
| SMILES | [Ga] |
| Synonym | gallium, elemental,metal,unii-ch46oc8yv4,ch46oc8yv4,ingot,pellets, 6mm dia,galio,metal, packaged in poylethylene bottle,gallium, ion ga1+,atom |
| IUPAC Name | gallium |
| InChI Key | GYHNNYVSQQEPJS-UHFFFAOYSA-N |
| Molecular Formula | Ga |
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.718 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.718 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
Boron trifluoride diethyl etherate, 46.5% BF{3} min, packaged under Argon in resealable ChemSeal™ bottles
CAS: 109-63-7 Molecular Formula: C4H10BF3O Molecular Weight (g/mol): 141.93 MDL Number: MFCD00013194 InChI Key: KZMGYPLQYOPHEL-UHFFFAOYSA-N PubChem CID: 8000 SMILES: FB(F)F.CCOCC
| PubChem CID | 8000 |
|---|---|
| CAS | 109-63-7 |
| Molecular Weight (g/mol) | 141.93 |
| MDL Number | MFCD00013194 |
| SMILES | FB(F)F.CCOCC |
| InChI Key | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molecular Formula | C4H10BF3O |
Lithium bis(trimethylsilyl)amide, 20% (ca 1.06M) soln. in THF/ethylbenzene, packaged in resealable septum cap bottle
CAS: 4039-32-1 Molecular Formula: C6H18LiNSi2 Molecular Weight (g/mol): 167.327 MDL Number: MFCD00008261 InChI Key: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC Name: lithium;bis(trimethylsilyl)azanide SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| PubChem CID | 2733832 |
|---|---|
| CAS | 4039-32-1 |
| Molecular Weight (g/mol) | 167.327 |
| MDL Number | MFCD00008261 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molecular Formula | C6H18LiNSi2 |
Zinc chloride, 1M in diethyl ether, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Boron trifluoride-dimethyl sulfide complex, purified, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 353-43-5 Molecular Formula: C2H6BF3S Molecular Weight (g/mol): 129.94 MDL Number: MFCD00013193 InChI Key: BRWZPVRDOUWXKE-UHFFFAOYSA-N Synonym: boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles PubChem CID: 71311438 IUPAC Name: dimethylsulfonio(trifluoro)boranuide SMILES: CSC.FB(F)F
| PubChem CID | 71311438 |
|---|---|
| CAS | 353-43-5 |
| Molecular Weight (g/mol) | 129.94 |
| MDL Number | MFCD00013193 |
| SMILES | CSC.FB(F)F |
| Synonym | boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles |
| IUPAC Name | dimethylsulfonio(trifluoro)boranuide |
| InChI Key | BRWZPVRDOUWXKE-UHFFFAOYSA-N |
| Molecular Formula | C2H6BF3S |
| Packaging | Plastic bottle |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Ringer's Solution |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
Sand, pure, 40-100 mesh
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Potassium chloride, extra pure
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium;chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium;chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Magnesium sulfate heptahydrate, 99.5%, for analysis
CAS: 10034-99-8 Molecular Formula: H14MgO11S Molecular Weight (g/mol): 246.47 MDL Number: MFCD00149785 InChI Key: WRUGWIBCXHJTDG-UHFFFAOYSA-L Synonym: magnesium sulfate heptahydrate,mgso4.7h2o,magnesium sulfate 1:1 heptahydrate,magnesium sulphate heptahydrate,unii-sk47b8698t,magnesium sulfate usan:jan,sulfuric acid magnesium salt 1:1 , heptahydrate,magnesium sulfate heptahydrate mgso4.7h2o,sulfuric acid, magnesium salt 1:1 , heptahydrate,magnesium ii , sulfate, heptahydrate PubChem CID: 24843 ChEBI: CHEBI:31795 IUPAC Name: magnesium;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24843 |
|---|---|
| CAS | 10034-99-8 |
| Molecular Weight (g/mol) | 246.47 |
| ChEBI | CHEBI:31795 |
| MDL Number | MFCD00149785 |
| SMILES | O.O.O.O.O.O.O.[Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate heptahydrate,mgso4.7h2o,magnesium sulfate 1:1 heptahydrate,magnesium sulphate heptahydrate,unii-sk47b8698t,magnesium sulfate usan:jan,sulfuric acid magnesium salt 1:1 , heptahydrate,magnesium sulfate heptahydrate mgso4.7h2o,sulfuric acid, magnesium salt 1:1 , heptahydrate,magnesium ii , sulfate, heptahydrate |
| IUPAC Name | magnesium;sulfate;heptahydrate |
| InChI Key | WRUGWIBCXHJTDG-UHFFFAOYSA-L |
| Molecular Formula | H14MgO11S |
Sodium chloride, 99+%, ACS reagent
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Zeolite ZSM-5, ammonium
CAS: 1318-02-1 Molecular Formula: Al2O5Si Molecular Weight (g/mol): 162.043 MDL Number: MFCD00132601 InChI Key: HNPSIPDUKPIQMN-UHFFFAOYSA-N Synonym: kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural PubChem CID: 9942228 IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane SMILES: O=[Al]O[Al]=O.O=[Si]=O
| PubChem CID | 9942228 |
|---|---|
| CAS | 1318-02-1 |
| Molecular Weight (g/mol) | 162.043 |
| MDL Number | MFCD00132601 |
| SMILES | O=[Al]O[Al]=O.O=[Si]=O |
| Synonym | kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural |
| IUPAC Name | dioxosilane;oxo(oxoalumanyloxy)alumane |
| InChI Key | HNPSIPDUKPIQMN-UHFFFAOYSA-N |
| Molecular Formula | Al2O5Si |
Sodium Bicarbonate (Fine White Powder), Fisher BioReagents™
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 IUPAC Name: sodium hydrogen carbonate SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| IUPAC Name | sodium hydrogen carbonate |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Magnesium sulfate, 99%, for analysis, anhydrous
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 IUPAC Name: magnesium;sulfate SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| IUPAC Name | magnesium;sulfate |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |