Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Oleyl alcohol, tech. 80-85%, Thermo Scientific Chemicals
CAS: 143-28-2 Molecular Formula: C18H36O Molecular Weight (g/mol): 268.49 MDL Number: MFCD00002993 InChI Key: ALSTYHKOOCGGFT-KTKRTIGZSA-N Synonym: oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol PubChem CID: 5284499 ChEBI: CHEBI:73504 IUPAC Name: (9Z)-octadec-9-en-1-ol SMILES: CCCCCCCC\C=C/CCCCCCCCO
| PubChem CID | 5284499 |
|---|---|
| CAS | 143-28-2 |
| Molecular Weight (g/mol) | 268.49 |
| ChEBI | CHEBI:73504 |
| MDL Number | MFCD00002993 |
| SMILES | CCCCCCCC\C=C/CCCCCCCCO |
| Synonym | oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol |
| IUPAC Name | (9Z)-octadec-9-en-1-ol |
| InChI Key | ALSTYHKOOCGGFT-KTKRTIGZSA-N |
| Molecular Formula | C18H36O |
| Molecular Weight (g/mol) | 397.63 |
|---|---|
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | Sucralose |
| Merck Index | XIII 8965 |
| Specific Rotation Condition | (20°C, 589 nm) (c=1% aq. soln.) |
| CAS | 56038-13-2 |
| Infrared Spectrum | Conforms |
| MDL Number | 03648615 |
| Specific Rotation | 84° to 88° |
| Packaging | Plastic bottle |
| Alpha Vector | SUCRALOSE |
| Synonym | Trichlorosucrose |
| RTECS Number | LW5440140 |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C12 H19 Cl3 O8 |
| EINECS Number | 259-952-2 |
| Melting Point | 130°C |
Lanolin, Thermo Scientific Chemicals
CAS: 8006-54-0 MDL Number: MFCD00081740 Synonym: dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer
| CAS | 8006-54-0 |
|---|---|
| MDL Number | MFCD00081740 |
| Synonym | dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer |
Deoxycholic acid, 99%, Thermo Scientific Chemicals
CAS: 83-44-3 Molecular Formula: C24H40O4 Molecular Weight (g/mol): 392.58 MDL Number: MFCD00003673 InChI Key: KXGVEGMKQFWNSR-LLQZFEROSA-N Synonym: deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol PubChem CID: 222528 ChEBI: CHEBI:28834 IUPAC Name: (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid SMILES: [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C
| PubChem CID | 222528 |
|---|---|
| CAS | 83-44-3 |
| Molecular Weight (g/mol) | 392.58 |
| ChEBI | CHEBI:28834 |
| MDL Number | MFCD00003673 |
| SMILES | [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| Synonym | deoxycholic acid,deoxycholate,desoxycholic acid,choleic acid,cholerebic,cholorebic,degalol,deoxycholatic acid,droxolan,pyrochol |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI Key | KXGVEGMKQFWNSR-LLQZFEROSA-N |
| Molecular Formula | C24H40O4 |
| Boiling Point | 152°C to 153°C |
|---|---|
| Molecular Weight (g/mol) | 284.48 |
| Color | Colorless or White to Yellow |
| Physical Form | Liquid or Powder |
| Chemical Name or Material | Methyl heptadecanoate |
| CAS | 1731-92-6 |
| Infrared Spectrum | Conforms |
| MDL Number | 00009001 |
| Packaging | Glass bottle |
| Flash Point | >110°C |
| Alpha Vector | METHYLHEPTADECANOATE |
| Synonym | Methyl margarate |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C18 H36 O2 |
| EINECS Number | 217-055-3 |
| Melting Point | 29°C to 30°C |
Diethylamine hydrochloride, 99%, Thermo Scientific Chemicals
CAS: 660-68-4 MDL Number: MFCD00012499 InChI Key: HDITUCONWLWUJR-UHFFFAOYSA-N Synonym: diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl PubChem CID: 10197650 IUPAC Name: N-ethylethanamine;hydrochloride SMILES: CCNCC.Cl
| PubChem CID | 10197650 |
|---|---|
| CAS | 660-68-4 |
| MDL Number | MFCD00012499 |
| SMILES | CCNCC.Cl |
| Synonym | diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl |
| IUPAC Name | N-ethylethanamine;hydrochloride |
| InChI Key | HDITUCONWLWUJR-UHFFFAOYSA-N |
L(+)-Arginine Hydrochloride, 98+%, Thermo Scientific Chemicals
CAS: 1119-34-2 Molecular Formula: C6H14N4O2·HCl Molecular Weight (g/mol): 210.67 MDL Number: MFCD00064550 InChI Key: KWTQSFXGGICVPE-WCCKRBBISA-N Synonym: l-arginine hydrochloride,arginine hydrochloride,l-arginine hcl,l-arginine monohydrochloride,h-arg-oh.hcl,r-gene,arginine monohydrochloride,argamine,l-arginine, monohydrochloride,unii-f7lth1e20y PubChem CID: 66250 IUPAC Name: (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride SMILES: C(CC(C(=O)O)N)CN=C(N)N.Cl
| PubChem CID | 66250 |
|---|---|
| CAS | 1119-34-2 |
| Molecular Weight (g/mol) | 210.67 |
| MDL Number | MFCD00064550 |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |
| Synonym | l-arginine hydrochloride,arginine hydrochloride,l-arginine hcl,l-arginine monohydrochloride,h-arg-oh.hcl,r-gene,arginine monohydrochloride,argamine,l-arginine, monohydrochloride,unii-f7lth1e20y |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChI Key | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Molecular Formula | C6H14N4O2·HCl |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
1H,1H,2H-Perfluoro-1-decene, 99%, Thermo Scientific™
CAS: 21652-58-4 Molecular Formula: C10H3F17 Molecular Weight (g/mol): 446.11 MDL Number: MFCD00039246 InChI Key: NKAMGQZDVMQEJL-UHFFFAOYSA-N Synonym: 1h,1h,2h-perfluoro-1-decene,perfluoro-n-octyl ethylene,perfluorooctyl ethylene,tridecafluoro 1-decene,1h,1h,2h-perfluorodec-1-ene,1h,1h,2h-heptadecafluoro-1-decene,perfluoroctyl ethylene,cf3 cf2 7ch=ch2,1-heptadecafluorooctyl ethene PubChem CID: 88990 IUPAC Name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene SMILES: FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C
| PubChem CID | 88990 |
|---|---|
| CAS | 21652-58-4 |
| Molecular Weight (g/mol) | 446.11 |
| MDL Number | MFCD00039246 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C |
| Synonym | 1h,1h,2h-perfluoro-1-decene,perfluoro-n-octyl ethylene,perfluorooctyl ethylene,tridecafluoro 1-decene,1h,1h,2h-perfluorodec-1-ene,1h,1h,2h-heptadecafluoro-1-decene,perfluoroctyl ethylene,cf3 cf2 7ch=ch2,1-heptadecafluorooctyl ethene |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene |
| InChI Key | NKAMGQZDVMQEJL-UHFFFAOYSA-N |
| Molecular Formula | C10H3F17 |
Nicotinic acid, specified according to the requirements of Ph. Eur, Thermo Scientific Chemicals
CAS: 59-67-6 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 123.11 MDL Number: MFCD00006391 InChI Key: PVNIIMVLHYAWGP-UHFFFAOYSA-N Synonym: nicotinic acid,niacin,3-pyridinecarboxylic acid,3-carboxypyridine,wampocap,acidum nicotinicum,apelagrin,pellagrin,akotin,daskil PubChem CID: 938 ChEBI: CHEBI:15940 IUPAC Name: pyridine-3-carboxylic acid SMILES: OC(=O)C1=CC=CN=C1
| PubChem CID | 938 |
|---|---|
| CAS | 59-67-6 |
| Molecular Weight (g/mol) | 123.11 |
| ChEBI | CHEBI:15940 |
| MDL Number | MFCD00006391 |
| SMILES | OC(=O)C1=CC=CN=C1 |
| Synonym | nicotinic acid,niacin,3-pyridinecarboxylic acid,3-carboxypyridine,wampocap,acidum nicotinicum,apelagrin,pellagrin,akotin,daskil |
| IUPAC Name | pyridine-3-carboxylic acid |
| InChI Key | PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| Molecular Formula | C6H5NO2 |
Diisopropylamine, 99%, Thermo Scientific Chemicals
CAS: 108-18-9 InChI Key: UAOMVDZJSHZZME-UHFFFAOYSA-N Synonym: diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine PubChem CID: 7912 IUPAC Name: N-propan-2-ylpropan-2-amine SMILES: CC(C)NC(C)C
| PubChem CID | 7912 |
|---|---|
| CAS | 108-18-9 |
| SMILES | CC(C)NC(C)C |
| Synonym | diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine |
| IUPAC Name | N-propan-2-ylpropan-2-amine |
| InChI Key | UAOMVDZJSHZZME-UHFFFAOYSA-N |
Acetylsalicylic acid, 99%, Thermo Scientific Chemicals
CAS: 50-78-2 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002430 InChI Key: BSYNRYMUTXBXSQ-UHFFFAOYSA-N Synonym: aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin PubChem CID: 2244 ChEBI: CHEBI:15365 IUPAC Name: 2-acetyloxybenzoic acid SMILES: CC(=O)OC1=CC=CC=C1C(O)=O
| PubChem CID | 2244 |
|---|---|
| CAS | 50-78-2 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:15365 |
| MDL Number | MFCD00002430 |
| SMILES | CC(=O)OC1=CC=CC=C1C(O)=O |
| Synonym | aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin |
| IUPAC Name | 2-acetyloxybenzoic acid |
| InChI Key | BSYNRYMUTXBXSQ-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
Diethylamine, 99+%, Thermo Scientific Chemicals
CAS: 109-89-7 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.14 MDL Number: MFCD00009032 InChI Key: HPNMFZURTQLUMO-UHFFFAOYSA-N Synonym: diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine PubChem CID: 8021 ChEBI: CHEBI:85259 SMILES: CCNCC
| PubChem CID | 8021 |
|---|---|
| CAS | 109-89-7 |
| Molecular Weight (g/mol) | 73.14 |
| ChEBI | CHEBI:85259 |
| MDL Number | MFCD00009032 |
| SMILES | CCNCC |
| Synonym | diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine |
| InChI Key | HPNMFZURTQLUMO-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |
tert-Butyllithium, 1.9M solution in pentane, AcroSeal™, Thermo Scientific Chemicals
CAS: 594-19-4 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00008795 InChI Key: BKDLGMUIXWPYGD-UHFFFAOYSA-N Synonym: tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn PubChem CID: 638178 SMILES: [Li]C(C)(C)C
| PubChem CID | 638178 |
|---|---|
| CAS | 594-19-4 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00008795 |
| SMILES | [Li]C(C)(C)C |
| Synonym | tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn |
| InChI Key | BKDLGMUIXWPYGD-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |