missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium oxalate, 99.5%, for analysis, ACROS Organics™
Brand: Acros Organics 270540010
Additional Details : Weight : 1.05000kg
| Quantity | 1kg |
|---|
Chemical Identifiers
| 62-76-0 | |
| 134 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| 6125 | |
| C(=O)(C(=O)[O-])[O-].[Na+].[Na+] |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| disodium;oxalate |
Specifications
| 20ppm max | |
| 20ppm max | |
| Plastic bottle | |
| White | |
| 1kg | |
| p.a. | |
| 99.5% | |
| NaO2CCO2Na | |
| 15,8781 | |
| Solubility in water: 37g/L (20°C). Other solubilities: 6.3 g/100mL water (100°C), insoluble in ethanol and ether | |
| C(=O)(C(=O)[O-])[O-].[Na+].[Na+] | |
| 134 | |
| 134 | |
| 99.5% |
| Sodium oxalate | |
| 0.05% max. (105°C) | |
| 100ppm max | |
| 250.0°C to 270.0°C | |
| 7 to 8.5 (2.5% soln. at 20°C) | |
| 62-76-0 | |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| disodium;oxalate | |
| 6125 | |
| Fine Powder | |
| Analysis |