Learn More
(R)-α-Methylphenylalanine hydrate, 98%, 98% ee, ACROS Organics™
Brand: Acros Organics 441295000
Additional Details : CAS : 17350-84-4 Weight : 0.05050kg
| Quantity | 500mg |
|---|
Chemical Identifiers
| 17350-84-4 | |
| 197.23 | |
| r-2-amino-2-methyl-3-phenylpropanoic acid, alpha-methyl-d-phenylalanine, alpha-methyl-d-phe, 2r-2-amino-2-methyl-3-phenylpropanoic acid, a-benzyl-d-ala, d-alpha-methyl phenylalanine, h-alpha-me-d-phe-oh, r-2-amimo-2-methyl-3-phenylpropanoic acid, r-2-amino-2-methyl-3-phenylpropionic acid, alpha-benzyl-d-ala | |
| (2R)-2-amino-2-methyl-3-phenylpropanoic acid |
| C10H13NO2·xH2O | |
| HYOWVAAEQCNGLE-SNVBAGLBSA-N | |
| 7023409 | |
| CC(CC1=CC=CC=C1)(C(=O)O)N |
Specifications
| (R)-α-Methylphenylalanine hydrate | |
| Authentic | |
| White to Yellow | |
| 500mg | |
| 17350-84-4 | |
| 100.0 | |
| C10H13NO2·xH2O | |
| HYOWVAAEQCNGLE-SNVBAGLBSA-N | |
| (2R)-2-amino-2-methyl-3-phenylpropanoic acid | |
| 7023409 | |
| Powder |
| 98.0% min. | |
| 18 | |
| >233°C | |
| 98% ee | |
| 97.5 | |
| 97.5% min. (HPLC) | |
| r-2-amino-2-methyl-3-phenylpropanoic acid, alpha-methyl-d-phenylalanine, alpha-methyl-d-phe, 2r-2-amino-2-methyl-3-phenylpropanoic acid, a-benzyl-d-ala, d-alpha-methyl phenylalanine, h-alpha-me-d-phe-oh, r-2-amimo-2-methyl-3-phenylpropanoic acid, r-2-amino-2-methyl-3-phenylpropionic acid, alpha-benzyl-d-ala | |
| CC(CC1=CC=CC=C1)(C(=O)O)N | |
| 197.23 | |
| 197.23 | |
| 98%,98% ee |
Safety and Handling
- (R)-alpha-Methylphenylalanine hydrate