Learn More
Hexafluorobenzene, 99%, ACROS Organics™
Brand: Acros Organics 120540100
Additional Details : Weight : 0.06620kg Transport : UN number : 1993 Chem class : 3 Pack group : II
| Packaging | Glass bottle |
|---|---|
| Quantity | 10mL |
Chemical Identifiers
| 392-56-3 | |
| 186.06 | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 9805 | |
| 1,2,3,4,5,6-hexafluorobenzene |
| C6F6 | |
| MFCD00000288 | |
| hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus | |
| CHEBI:38589 | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F |
Specifications
| Hexafluorobenzene | |
| 10°C | |
| Glass bottle | |
| 1.612 | |
| Colorless to Yellow | |
| 10mL | |
| 98.5% min. (GC) | |
| C6F6 | |
| 15,4722 | |
| Solubility in water: immiscible. Other solubilities: soluble in ethanol | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F | |
| 186.06 | |
| CHEBI:38589 | |
| Liquid |
| 1.6120g/mL | |
| Authentic | |
| 1.3760 to 1.3780 | |
| 81.0°C to 82.0°C (743.0mmHg) | |
| 3.7°C to 4.1°C | |
| 392-56-3 | |
| C6F6 | |
| MFCD00000288 | |
| hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 1,2,3,4,5,6-hexafluorobenzene | |
| 9805 | |
| 186.06 | |
| 99% |
Safety and Handling
- benzene fluoro 6
Signal Word
- Danger
Hazard Category
- Flammable liquid Category 2
Hazard Statement
- H225-Highly flammable liquid and vapour.
Precautionary Statement
- P210-Keep away from heat, hot surfaces, sparks, open flames and other ignition sources. No smoking.
- P240-Ground/bond container and receiving equipment.