missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Glycerine trioleate, 99%, ACROS Organics™
Brand: Acros Organics 368120250
Additional Details : Weight : 0.07282kg
| Quantity | 25mL |
|---|
Chemical Identifiers
| 122-32-7 | |
| 885.453 | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| 45253964 |
| C57H104O6 | |
| MFCD00137563 | |
| 1, 2, 3-Tri(cis-9-octadecenoyl)glycerol, Triolein |
Specifications
| Glycerine trioleate | |
| 122-32-7 | |
| 99% | |
| C57H104O6 | |
| MFCD00137563 | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| [2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate | |
| 45253964 | |
| 885.45 | |
| Glass bottle | |
| Solubility in water: insoluble in water. Other solubilities: soluble in chloroform, ether, ccl4, slightly soluble in alcohol | |
| Colorless through Yellow |
| 25mL | |
| 99% | |
| 0.9130g/mL | |
| (C17H33COOCH2)2CHOCOC17H33 | |
| 1, 2, 3-Tri(cis-9-octadecenoyl)glycerol, Triolein | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
| 885.453 | |
| Authentic | |
| Liquid | |
| 1.4680 to 1.4700 | |
| 0.913 | |
| 235.0°C to 240.0°C (18.0mmHg) |