missing translation for 'onlineSavingsMsg'
Learn More
Learn More
DL-Tryptophan, 98%, ACROS Organics™
Brand: Acros Organics 172110250
Additional Details : Weight : 0.07500kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 54-12-6 | |
| 204.229 | |
| QIVBCDIJIAJPQS-UHFFFAOYSA-N | |
| 1148 | |
| 2-amino-3-(1H-indol-3-yl)propanoic acid |
| C11H12N2O2 | |
| MFCD00064339 | |
| dl-tryptophan, 2-amino-3-1h-indol-3-yl propanoic acid, racemic tryptophan, dl-trytophane, dl-trytophan, +--tryptophan, h-dl-trp-oh, dl-3beta-indolylalanine, dl-tryptophane, tryptophan . | |
| CHEBI:27897 | |
| C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
Specifications
| DL-Tryptophan | |
| 54-12-6 | |
| 98% | |
| Authentic | |
| 22, 550 | |
| (TLC) Not detected | |
| Plastic bottle | |
| C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N | |
| 204.229 | |
| CHEBI:27897 | |
| Crystalline Powder | |
| Beige to White or Yellow |
| 99% | |
| (1% in 1M HCl) clear to slightly hazy, colorless to yellow solution | |
| C11H12N2O2 | |
| MFCD00064339 | |
| 0.8% max. (105°C, 3 hrs) (vacuum) | |
| dl-tryptophan, 2-amino-3-1h-indol-3-yl propanoic acid, racemic tryptophan, dl-trytophane, dl-trytophan, +--tryptophan, h-dl-trp-oh, dl-3beta-indolylalanine, dl-tryptophane, tryptophan . | |
| QIVBCDIJIAJPQS-UHFFFAOYSA-N | |
| 2-amino-3-(1H-indol-3-yl)propanoic acid | |
| 1148 | |
| 204.23 | |
| ≥97.5% | |
| 25g |