missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cresyl Violet acetate, pure, certified, ACROS Organics™
Brand: Acros Organics 405760500
Additional Details : Weight : 0.10000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 50g |
Chemical Identifiers
| 10510-54-0 | |
| 321.336 | |
| 44134641 | |
| CC(=O)O.C1=CC=C2C(=C1)C(=N)C=C3C2=NC4=C(O3)C=C(C=C4)N |
| C18H15N3O3 | |
| UEWSHLFAYRXNHZ-UHFFFAOYSA-N | |
| acetic acid;5-iminobenzo[a]phenoxazin-9-amine |
Specifications
| Cresyl Violet acetate | |
| 0.94 to 1.2 | |
| C18H15N3O3 | |
| Authentic | |
| acetic acid;5-iminobenzo[a]phenoxazin-9-amine | |
| 596 to 599nm | |
| 321.34 | |
| Pure | |
| Solubility in water: soluble in water. Other solubilities: soluble in ethanol, insoluble in aceton | |
| Black to Green |
| 10510-54-0 | |
| 65% min. | |
| UEWSHLFAYRXNHZ-UHFFFAOYSA-N | |
| CC(=O)O.C1=CC=C2C(=C1)C(=N)C=C3C2=NC4=C(O3)C=C(C=C4)N | |
| 321.336 | |
| 44134641 | |
| Fine Crystalline Powder | |
| Glass bottle | |
| 140.0°C to 143.0°C | |
| 50g |