missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Chloramphenicol, 98%, ACROS Organics™
Brand: Acros Organics 227925000
Additional Details : Weight : 0.55000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 500g |
Chemical Identifiers
| 56-75-7 | |
| 323.126 | |
| WIIZWVCIJKGZOK-RKDXNWHRSA-N | |
| 5959 | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| C11H12Cl2N2O5 | |
| MFCD00078159 | |
| Chloromycetin, D(-)-threo-2, 2-Dichloro-N-[β-hydroxy-α-(hydroxy-methyl)-p-nitrophenylethyl]acetamide | |
| CHEBI:17698 | |
| C1=CC(=CC=C1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
Specifications
| Chloramphenicol | |
| 98% | |
| MFCD00078159 | |
| Chloromycetin, D(-)-threo-2, 2-Dichloro-N-[β-hydroxy-α-(hydroxy-methyl)-p-nitrophenylethyl]acetamide | |
| C1=CC(=CC=C1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] | |
| 323.126 | |
| CHEBI:17698 | |
| 98% | |
| + 18.50 | |
| 149.0°C to 153.0°C |
| 56-75-7 | |
| C11H12Cl2N2O5 | |
| Glass bottle | |
| WIIZWVCIJKGZOK-RKDXNWHRSA-N | |
| 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide | |
| 5959 | |
| 323.13 | |
| Solubility in water: 2.5g/L (25°C). Other solubilities: 150.8 mg/mL propylene glycol, soluble in methanol, ethanol, butanol, acetone and, ethyl acetate - slightly soluble in ether, insoluble in benzene and petroleum ether | |
| + 18.50 (20.50°C c=6,C2H5OH) | |
| 500g |
Safety and Handling
Product Identifier
Signal Word
Hazard Category
Hazard Statement
Precautionary Statement
- Chloramphenicol
Signal Word
- Danger
Hazard Category
- Carcinogenicity Category 1B
Hazard Statement
- H350-May cause cancer.
Precautionary Statement
- P201-Obtain special instructions before use.
- P308+P313-IF exposed or concerned: Get medical advice/attention.