missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(2-ethylhexyl) adipate, 99%, ACROS Organics™
Brand: Acros Organics 402460025
Additional Details : Weight : 2.55000kg
Packaging | Glass bottle |
---|---|
Quantity | 2.5kg |
Chemical Identifiers
103-23-1 | |
370.57 | |
SAOKZLXYCUGLFA-UHFFFAOYSA-N | |
7641 | |
bis(2-ethylhexyl) hexanedioate |
C22H42O4 | |
MFCD00009496 | |
bis 2-ethylhexyl adipate, di 2-ethylhexyl adipate, diethylhexyl adipate, deha, plastomoll doa, beha, vestinol oa, bisoflex doa, effomoll doa | |
CHEBI:34675 | |
CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Specifications
Bis(2-ethylhexyl) adipate | |
196°C | |
Glass bottle | |
0.924 | |
210.0°C to 218.0°C (5.0mmHg) | |
-76.0°C | |
103-23-1 | |
100.0 | |
C22H42O4 | |
bis 2-ethylhexyl adipate, di 2-ethylhexyl adipate, diethylhexyl adipate, deha, plastomoll doa, beha, vestinol oa, bisoflex doa, effomoll doa | |
SAOKZLXYCUGLFA-UHFFFAOYSA-N | |
bis(2-ethylhexyl) hexanedioate | |
7641 | |
370.57 | |
99% |
0.9240g/mL | |
Authentic | |
1.4460 to 1.4480 | |
13-15 mPa.s (20°C) | |
Undesignated | |
2.5kg | |
98.5 | |
98.5% min. (GC) | |
MFCD00009496 | |
Solubility in water: insouble. Other solubilities: soluble in aceton,ether,ethanol | |
CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC | |
370.57 | |
CHEBI:34675 | |
Liquid |