Learn More
1-Iodo-4-nitrobenzene, 99%, ACROS Organics™
Brand: Acros Organics 122381000
Additional Details : CAS : 636-98-6 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 636-98-6 | |
| 249.01 | |
| SCCCFNJTCDSLCY-UHFFFAOYSA-N | |
| 12495 | |
| C1=CC(=CC=C1[N+](=O)[O-])I |
| C6H4INO2 | |
| MFCD00007299 | |
| benzene, 1-iodo-4-nitro, p-iodonitrobenzene, 4-iodonitrobenzene, p-nitroiodobenzene, 4-nitroiodobenzene, 4-iodo-nitrobenzene, p-nitrophenyl iodide, 1-iodo-4-nitro-benzene, 4-iodo-1-nitrobenzene, 4-nitro-1-iodobenzene | |
| 1-iodo-4-nitrobenzene |
Specifications
| 1-Iodo-4-nitrobenzene | |
| Authentic | |
| 289.0°C (772.0 mmHg) | |
| 171.0°C to 173.0°C | |
| 99% | |
| 98.5 | |
| 98.5% min. (GC) | |
| IC6H4NO2 | |
| 05, 253 | |
| Solubility in water: insoluble | |
| C1=CC(=CC=C1[N+](=O)[O-])I | |
| 249.01 | |
| 249.01 | |
| 99% |
| 100°C | |
| Glass bottle | |
| Brown | |
| 100g | |
| 636-98-6 | |
| 100.0 | |
| C6H4INO2 | |
| MFCD00007299 | |
| benzene, 1-iodo-4-nitro, p-iodonitrobenzene, 4-iodonitrobenzene, p-nitroiodobenzene, 4-nitroiodobenzene, 4-iodo-nitrobenzene, p-nitrophenyl iodide, 1-iodo-4-nitro-benzene, 4-iodo-1-nitrobenzene, 4-nitro-1-iodobenzene | |
| SCCCFNJTCDSLCY-UHFFFAOYSA-N | |
| 1-iodo-4-nitrobenzene | |
| 12495 | |
| Powder |
Safety and Handling
- 1-Iodo-4-nitrobenzene
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H315-Causes skin irritation.
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H312-Harmful in contact with skin.
- H332-Harmful if inhaled.
- H302-Harmful if swallowed.
Precautionary Statement
- P260-Do not breathe dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P304+P340-IF INHALED: Remove person to fresh air and keep comfortable for breathing.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.